The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((3-Chlorobenzyl)thio)-4-((2,4,5-trifluorobenzyl)thio)-1,3,5-triazin-2(1H)-one ID: ALA4475269
PubChem CID: 155537510
Max Phase: Preclinical
Molecular Formula: C17H11ClF3N3OS2
Molecular Weight: 429.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1nc(SCc2cc(F)c(F)cc2F)nc(SCc2cccc(Cl)c2)[nH]1
Standard InChI: InChI=1S/C17H11ClF3N3OS2/c18-11-3-1-2-9(4-11)7-26-16-22-15(25)23-17(24-16)27-8-10-5-13(20)14(21)6-12(10)19/h1-6H,7-8H2,(H,22,23,24,25)
Standard InChI Key: UGRXQEHAMWBPHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
28.8397 -4.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8385 -5.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5466 -5.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2562 -5.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2534 -4.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5448 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9596 -4.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9565 -3.2872 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.6626 -2.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3670 -3.2847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0711 -2.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0722 -2.0594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3631 -1.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6529 -2.0608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7788 -3.2856 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.7788 -4.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3628 -0.8341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4865 -4.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4844 -5.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1912 -5.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8999 -5.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8973 -4.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1899 -4.1030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5464 -6.5650 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
35.1873 -3.2858 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.6082 -5.7369 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.1908 -6.5550 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
13 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
3 24 1 0
23 25 1 0
21 26 1 0
20 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.88Molecular Weight (Monoisotopic): 428.9984AlogP: 4.82#Rotatable Bonds: 6Polar Surface Area: 58.64Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.38CX Basic pKa: ┄CX LogP: 5.84CX LogD: 4.93Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.45Np Likeness Score: -1.98
References 1. Bergant K, Janežič M, Valjavec K, Sosič I, Pajk S, Štampar M, Žegura B, Gobec S, Filipič M, Perdih A.. (2019) Structure-guided optimization of 4,6-substituted-1,3,5-triazin-2(1H)-ones as catalytic inhibitors of human DNA topoisomerase IIα., 175 [PMID:31096154 ] [10.1016/j.ejmech.2019.04.055 ]