5-((Allyloxy)methyl)-3-(5-bromo-2-methoxyphenyl)isoxazole

ID: ALA4475333

PubChem CID: 155537594

Max Phase: Preclinical

Molecular Formula: C14H14BrNO3

Molecular Weight: 324.17

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCOCc1cc(-c2cc(Br)ccc2OC)no1

Standard InChI:  InChI=1S/C14H14BrNO3/c1-3-6-18-9-11-8-13(16-19-11)12-7-10(15)4-5-14(12)17-2/h3-5,7-8H,1,6,9H2,2H3

Standard InChI Key:  XXIDPYMMPGCDQF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   29.7655  -13.3846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0985  -13.8667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3528  -14.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1741  -14.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4285  -13.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2300  -15.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2289  -15.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9369  -16.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6466  -15.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6438  -15.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9351  -14.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9327  -13.8383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1317  -13.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2238  -13.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8437  -13.8516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9367  -17.1100    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   32.5470  -13.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2591  -13.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9624  -13.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  1  2  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 10  3  1  0
  5 13  1  0
 12 14  1  0
 13 15  1  0
  8 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4475333

    ---

Associated Targets(non-human)

BV-2 (3710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.17Molecular Weight (Monoisotopic): 323.0157AlogP: 3.82#Rotatable Bonds: 6
Polar Surface Area: 44.49Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.60Np Likeness Score: -1.11

References

1. Yuan Y, Subedi L, Lim D, Jung JK, Kim SY, Seo SY..  (2019)  Synthesis and anti-neuroinflammatory activity of N-heterocyclic analogs based on natural biphenyl-neolignan honokiol.,  29  (2): [PMID:30472026] [10.1016/j.bmcl.2018.11.014]

Source