The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((2-Acrylamidophenyl)amino)-N-(4,5-dimethoxy-2-methylphenyl)-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidine-5-carboxamide ID: ALA4475369
PubChem CID: 155415583
Max Phase: Preclinical
Molecular Formula: C34H38N8O4
Molecular Weight: 622.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C(=O)Nc1cc(OC)c(OC)cc1C
Standard InChI: InChI=1S/C34H38N8O4/c1-6-31(43)37-26-9-7-8-10-27(26)38-32-25(33(44)39-28-20-30(46-5)29(45-4)19-22(28)2)21-35-34(40-32)36-23-11-13-24(14-12-23)42-17-15-41(3)16-18-42/h6-14,19-21H,1,15-18H2,2-5H3,(H,37,43)(H,39,44)(H2,35,36,38,40)
Standard InChI Key: QXUDOYJGRSEHPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
29.7559 -14.5072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7548 -15.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4628 -15.7357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1725 -15.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1696 -14.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4610 -14.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0467 -15.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8808 -15.7337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0461 -16.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8821 -16.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3379 -16.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3369 -17.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0449 -18.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7552 -17.7724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7527 -16.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1737 -16.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1747 -17.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8835 -18.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5929 -17.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5885 -16.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0453 -19.0020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3352 -19.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3336 -20.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0398 -20.6334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7491 -20.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7522 -19.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0371 -21.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2942 -16.5425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0039 -16.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7096 -16.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4193 -16.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0079 -17.7648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8758 -14.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5850 -14.4982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8727 -13.2751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5789 -12.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2834 -13.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9891 -12.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9864 -12.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2722 -11.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5695 -12.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8579 -11.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6921 -11.6325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4018 -12.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6981 -13.2690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7008 -14.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
4 8 1 0
7 9 1 0
8 10 1 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
13 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
20 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
29 32 2 0
5 33 1 0
33 34 2 0
33 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
41 42 1 0
39 43 1 0
43 44 1 0
38 45 1 0
45 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 622.73Molecular Weight (Monoisotopic): 622.3016AlogP: 5.42#Rotatable Bonds: 11Polar Surface Area: 132.98Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.95CX Basic pKa: 7.96CX LogP: 6.74CX LogD: 6.08Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.16Np Likeness Score: -1.31
References 1. Du G, Rao S, Gurbani D, Henning NJ, Jiang J, Che J, Yang A, Ficarro SB, Marto JA, Aguirre AJ, Sorger PK, Westover KD, Zhang T, Gray NS.. (2020) Structure-Based Design of a Potent and Selective Covalent Inhibitor for SRC Kinase That Targets a P-Loop Cysteine., 63 (4): [PMID:31935084 ] [10.1021/acs.jmedchem.9b01502 ]