4-((2-Acrylamidophenyl)amino)-N-(4,5-dimethoxy-2-methylphenyl)-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidine-5-carboxamide

ID: ALA4475369

PubChem CID: 155415583

Max Phase: Preclinical

Molecular Formula: C34H38N8O4

Molecular Weight: 622.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C(=O)Nc1cc(OC)c(OC)cc1C

Standard InChI:  InChI=1S/C34H38N8O4/c1-6-31(43)37-26-9-7-8-10-27(26)38-32-25(33(44)39-28-20-30(46-5)29(45-4)19-22(28)2)21-35-34(40-32)36-23-11-13-24(14-12-23)42-17-15-41(3)16-18-42/h6-14,19-21H,1,15-18H2,2-5H3,(H,37,43)(H,39,44)(H2,35,36,38,40)

Standard InChI Key:  QXUDOYJGRSEHPZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 46 50  0  0  0  0  0  0  0  0999 V2000
   29.7559  -14.5072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7548  -15.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4628  -15.7357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1725  -15.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1696  -14.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4610  -14.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0467  -15.7347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8808  -15.7337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0461  -16.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8821  -16.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3379  -16.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3369  -17.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0449  -18.1848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7552  -17.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7527  -16.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1737  -16.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1747  -17.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8835  -18.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5929  -17.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5885  -16.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0453  -19.0020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3352  -19.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3336  -20.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0398  -20.6334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7491  -20.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7522  -19.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0371  -21.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2942  -16.5425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0039  -16.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7096  -16.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4193  -16.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0079  -17.7648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8758  -14.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5850  -14.4982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8727  -13.2751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5789  -12.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2834  -13.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9891  -12.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9864  -12.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2722  -11.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5695  -12.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8579  -11.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6921  -11.6325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4018  -12.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6981  -13.2690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7008  -14.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  4  8  1  0
  7  9  1  0
  8 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  9  1  0
 10 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 10  1  0
 13 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 20 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 29 32  2  0
  5 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 41 42  1  0
 39 43  1  0
 43 44  1  0
 38 45  1  0
 45 46  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475369

    ---

Associated Targets(Human)

FGFR1 Tclin Fibroblast growth factor receptor 1 (9149 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SRC Tclin Tyrosine-protein kinase SRC (10310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 622.73Molecular Weight (Monoisotopic): 622.3016AlogP: 5.42#Rotatable Bonds: 11
Polar Surface Area: 132.98Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.95CX Basic pKa: 7.96CX LogP: 6.74CX LogD: 6.08
Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.16Np Likeness Score: -1.31

References

1. Du G, Rao S, Gurbani D, Henning NJ, Jiang J, Che J, Yang A, Ficarro SB, Marto JA, Aguirre AJ, Sorger PK, Westover KD, Zhang T, Gray NS..  (2020)  Structure-Based Design of a Potent and Selective Covalent Inhibitor for SRC Kinase That Targets a P-Loop Cysteine.,  63  (4): [PMID:31935084] [10.1021/acs.jmedchem.9b01502]

Source