The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-methoxy-5-oxo-N-(3,4,5-trimethoxybenzyl)-1,2,3,5-tetrahydroindolizine-8-carboxamide ID: ALA4475383
Cas Number: 2034513-90-9
PubChem CID: 92130730
Max Phase: Preclinical
Molecular Formula: C20H24N2O6
Molecular Weight: 388.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)c2c(OC)cc(=O)n3c2CCC3)cc(OC)c1OC
Standard InChI: InChI=1S/C20H24N2O6/c1-25-14-10-17(23)22-7-5-6-13(22)18(14)20(24)21-11-12-8-15(26-2)19(28-4)16(9-12)27-3/h8-10H,5-7,11H2,1-4H3,(H,21,24)
Standard InChI Key: RYWLDBHNDSBOKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
15.0396 -10.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4502 -11.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4502 -10.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7449 -10.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7449 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0374 -11.4817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4378 -12.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7747 -12.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5825 -12.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1591 -10.2541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1615 -9.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3313 -10.2532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1573 -11.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1561 -12.7046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8656 -11.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8668 -10.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5751 -10.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2778 -10.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9856 -10.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9872 -9.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2752 -9.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5702 -9.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2735 -8.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9803 -7.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6950 -9.0349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4027 -9.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6925 -10.6714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6909 -11.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
1 4 1 0
5 2 2 0
2 3 1 0
3 4 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
1 12 2 0
2 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
20 25 1 0
25 26 1 0
19 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.42Molecular Weight (Monoisotopic): 388.1634AlogP: 1.76#Rotatable Bonds: 7Polar Surface Area: 88.02Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.31CX LogD: 0.31Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: -0.72
References 1. Zhou Y, Tao P, Wang M, Xu P, Lu W, Lei P, You Q.. (2019) Development of novel human lactate dehydrogenase A inhibitors: High-throughput screening, synthesis, and biological evaluations., 177 [PMID:31129449 ] [10.1016/j.ejmech.2019.05.033 ]