The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-acetyl-4-(4-(dimethylamino)phenyl)indeno[2,1-e]pyrrolo[2,3-b]pyridin-5(1H)-one ID: ALA4475411
PubChem CID: 129908047
Max Phase: Preclinical
Molecular Formula: C24H19N3O2
Molecular Weight: 381.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cc2c(-c3ccc(N(C)C)cc3)c3c(nc2[nH]1)-c1ccccc1C3=O
Standard InChI: InChI=1S/C24H19N3O2/c1-13(28)19-12-18-20(14-8-10-15(11-9-14)27(2)3)21-22(26-24(18)25-19)16-6-4-5-7-17(16)23(21)29/h4-12H,1-3H3,(H,25,26)
Standard InChI Key: WANWGZTZQXJMJU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
13.2484 -17.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5027 -17.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8398 -16.6864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4312 -17.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1814 -17.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3863 -16.9993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8892 -18.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0947 -18.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8396 -17.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4367 -18.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7749 -18.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0251 -17.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4790 -17.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6826 -17.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4352 -17.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9830 -18.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1421 -19.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5947 -19.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8480 -20.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6484 -20.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1950 -20.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9388 -19.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4400 -19.6806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2803 -16.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8868 -17.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4513 -16.1180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9033 -21.6522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3584 -22.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7032 -21.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 2 0
2 3 1 0
3 5 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 12 1 0
11 10 1 0
10 8 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
7 17 1 0
10 23 2 0
2 24 1 0
24 25 1 0
24 26 2 0
20 27 1 0
27 28 1 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 381.44Molecular Weight (Monoisotopic): 381.1477AlogP: 4.71#Rotatable Bonds: 3Polar Surface Area: 66.06Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.58CX Basic pKa: 4.46CX LogP: 3.97CX LogD: 3.97Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -0.25
References 1. Stanton RA, Lu X, Detorio M, Montero C, Hammond ET, Ehteshami M, Domaoal RA, Nettles JH, Feraud M, Schinazi RF.. (2016) Discovery, characterization, and lead optimization of 7-azaindole non-nucleoside HIV-1 reverse transcriptase inhibitors., 26 (16): [PMID:27390064 ] [10.1016/j.bmcl.2016.06.065 ]