The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-amino-1-deoxy-N-(6-(4-propyl-1H-1,2,3-triazol-1-yl)hexyl)-5,6-oxomethylidenemannojirimycin ID: ALA4475419
PubChem CID: 155537715
Max Phase: Preclinical
Molecular Formula: C18H31N5O5
Molecular Weight: 397.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1cn(CCCCCCN[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@H]3COC(=O)N32)nn1
Standard InChI: InChI=1S/C18H31N5O5/c1-2-7-12-10-22(21-20-12)9-6-4-3-5-8-19-17-16(26)15(25)14(24)13-11-28-18(27)23(13)17/h10,13-17,19,24-26H,2-9,11H2,1H3/t13-,14-,15+,16+,17+/m1/s1
Standard InChI Key: HSQDVSJTSXTCOQ-NRKLIOEPSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
6.8677 -5.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8677 -6.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5771 -6.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2865 -6.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5771 -5.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2857 -5.4960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8906 -4.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5600 -4.2041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7466 -4.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7114 -4.9485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9980 -6.7363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5771 -7.5528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1565 -6.7367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1547 -5.0951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8595 -4.6762 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.9957 -7.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7022 -7.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4111 -7.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1177 -7.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8265 -7.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5331 -7.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5308 -8.7892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8703 -9.2694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1207 -10.0473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9379 -10.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1925 -9.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6405 -10.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3478 -10.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0559 -10.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 5 1 0
2 3 1 0
3 4 1 0
4 6 1 0
5 6 1 0
6 7 1 1
7 8 1 0
8 9 1 0
9 5 1 0
7 10 2 0
4 11 1 6
3 12 1 1
2 13 1 1
1 14 1 6
5 15 1 6
11 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 22 1 0
25 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.48Molecular Weight (Monoisotopic): 397.2325AlogP: -0.38#Rotatable Bonds: 10Polar Surface Area: 132.97Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.72CX Basic pKa: 7.81CX LogP: 0.42CX LogD: -0.14Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: -0.50
References 1. Rísquez-Cuadro R, Matsumoto R, Ortega-Caballero F, Nanba E, Higaki K, García Fernández JM, Ortiz Mellet C.. (2019) Pharmacological Chaperones for the Treatment of α-Mannosidosis., 62 (12): [PMID:31017416 ] [10.1021/acs.jmedchem.9b00153 ]