The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 3-(4-(4-(2,5-difluorophenylsulfonamido)-2-fluorophenoxy)-6-methoxyquinolin-7-yloxy)propylcarbamate ID: ALA4475420
PubChem CID: 67074801
Max Phase: Preclinical
Molecular Formula: C30H30F3N3O7S
Molecular Weight: 633.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Oc3ccc(NS(=O)(=O)c4cc(F)ccc4F)cc3F)ccnc2cc1OCCCNC(=O)OC(C)(C)C
Standard InChI: InChI=1S/C30H30F3N3O7S/c1-30(2,3)43-29(37)35-11-5-13-41-27-17-23-20(16-26(27)40-4)24(10-12-34-23)42-25-9-7-19(15-22(25)33)36-44(38,39)28-14-18(31)6-8-21(28)32/h6-10,12,14-17,36H,5,11,13H2,1-4H3,(H,35,37)
Standard InChI Key: QXULVPRJAQIXKR-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
25.8901 -4.1561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4856 -3.4504 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.0767 -4.1535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8464 -5.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8453 -6.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5533 -7.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5515 -5.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2602 -5.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2609 -6.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9695 -7.1491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6777 -6.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6730 -5.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9639 -5.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9595 -4.6956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6651 -4.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3704 -4.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0754 -4.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0715 -3.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3567 -3.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6545 -3.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7765 -3.0485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1919 -3.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8991 -3.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6049 -3.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6023 -2.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8881 -1.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1853 -2.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9424 -3.0704 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.1372 -7.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1386 -5.5182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4310 -5.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4299 -6.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4744 -1.8231 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.3139 -3.4435 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.7218 -7.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0144 -6.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3064 -7.1520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5990 -6.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5997 -5.9256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8910 -7.1509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1836 -6.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4756 -7.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1843 -5.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4713 -6.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
5 29 1 0
4 30 1 0
30 31 1 0
29 32 1 0
27 33 1 0
24 34 1 0
32 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 2 0
38 40 1 0
40 41 1 0
41 42 1 0
41 43 1 0
41 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 633.65Molecular Weight (Monoisotopic): 633.1757AlogP: 6.55#Rotatable Bonds: 11Polar Surface Area: 125.08Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.58CX Basic pKa: 5.73CX LogP: 4.68CX LogD: 4.31Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: -1.42
References 1. Szabadkai I, Torka R, Garamvölgyi R, Baska F, Gyulavári P, Boros S, Illyés E, Choidas A, Ullrich A, Őrfi L.. (2018) Discovery of N-[4-(Quinolin-4-yloxy)phenyl]benzenesulfonamides as Novel AXL Kinase Inhibitors., 61 (14): [PMID:29928803 ] [10.1021/acs.jmedchem.8b00672 ]