(1R,2S)-2-N-(4-chlorobenzyl)aminoethyl-1-(4-methyl-1-piperazinyl)cyclopropane

ID: ALA4475476

PubChem CID: 155538072

Max Phase: Preclinical

Molecular Formula: C17H26ClN3

Molecular Weight: 307.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN([C@@H]2C[C@@H]2CCNCc2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C17H26ClN3/c1-20-8-10-21(11-9-20)17-12-15(17)6-7-19-13-14-2-4-16(18)5-3-14/h2-5,15,17,19H,6-13H2,1H3/t15-,17+/m0/s1

Standard InChI Key:  XPDQKBVFGXKRBJ-DOTOQJQBSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   18.5485  -18.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3734  -18.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9609  -17.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0929  -18.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8089  -18.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8332  -18.7075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5245  -18.7020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2377  -18.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9531  -18.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9529  -19.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6675  -19.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3817  -19.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3768  -18.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6615  -18.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0976  -19.9274    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.1194  -18.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4061  -18.7061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4054  -19.5346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1243  -19.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8437  -19.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6913  -19.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  3  1  0
  2  4  1  6
  4  5  1  0
  1  6  1  6
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
  6 16  1  0
  6 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475476

    ---

Associated Targets(Human)

HRH3 Tclin Histamine H3 receptor (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HRH4 Tchem Histamine H4 receptor (3997 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 307.87Molecular Weight (Monoisotopic): 307.1815AlogP: 2.46#Rotatable Bonds: 6
Polar Surface Area: 18.51Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.55CX LogP: 2.53CX LogD: -0.57
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.81Np Likeness Score: -0.62

References

1. Watanabe M, Kobayashi T, Ito Y, Fukuda H, Yamada S, Arisawa M, Shuto S..  (2018)  Design and synthesis of histamine H3/H4 receptor ligands with a cyclopropane scaffold.,  28  (23-24): [PMID:30385161] [10.1016/j.bmcl.2018.10.041]

Source