The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-Ethoxyphenyl)-9-(3-((4-methyl-5-phenyl-4H-1,2,4-triazol-3-yl)thio)propyl)-3,9-diazaspiro[5.5]undecane ID: ALA4475482
PubChem CID: 142573395
Max Phase: Preclinical
Molecular Formula: C29H39N5OS
Molecular Weight: 505.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccccc1N1CCC2(CCN(CCCSc3nnc(-c4ccccc4)n3C)CC2)CC1
Standard InChI: InChI=1S/C29H39N5OS/c1-3-35-26-13-8-7-12-25(26)34-21-16-29(17-22-34)14-19-33(20-15-29)18-9-23-36-28-31-30-27(32(28)2)24-10-5-4-6-11-24/h4-8,10-13H,3,9,14-23H2,1-2H3
Standard InChI Key: UAYHHCOSZYIZOH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
38.3791 -10.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0849 -11.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7877 -10.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7909 -9.7919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0852 -9.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3762 -9.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9717 -10.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9717 -11.4200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6770 -11.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3823 -11.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6770 -10.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4959 -9.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2029 -9.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9112 -9.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9137 -8.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2021 -8.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4967 -8.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7889 -8.1613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7888 -7.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2646 -11.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5563 -11.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8492 -11.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1409 -11.4241 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.4338 -11.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6873 -11.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1413 -12.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5510 -12.8142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3500 -12.6430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5179 -10.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3287 -12.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9960 -11.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1840 -11.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7037 -11.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0413 -12.6019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8524 -12.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0810 -6.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 1 1 0
1 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
4 12 1 0
17 18 1 0
18 19 1 0
8 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 2 0
25 29 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
26 30 1 0
19 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.73Molecular Weight (Monoisotopic): 505.2875AlogP: 5.75#Rotatable Bonds: 9Polar Surface Area: 46.42Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.35CX LogP: 5.20CX LogD: 3.25Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -1.66
References 1. Reilly SW, Riad AA, Hsieh CJ, Sahlholm K, Jacome DA, Griffin S, Taylor M, Weng CC, Xu K, Kirschner N, Luedtke RR, Parry C, Malhotra S, Karanicolas J, Mach RH.. (2019) Leveraging a Low-Affinity Diazaspiro Orthosteric Fragment to Reduce Dopamine D3 Receptor (D3 R) Ligand Promiscuity across Highly Conserved Aminergic G-Protein-Coupled Receptors (GPCRs)., 62 (10): [PMID:31021617 ] [10.1021/acs.jmedchem.9b00412 ]