The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((2-(Dimethylphosphoryl)phenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)-2-fluoro-N-(piperidin-4-yl)benzamide ID: ALA4475488
PubChem CID: 155538008
Max Phase: Preclinical
Molecular Formula: C26H29FN7O2P
Molecular Weight: 521.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)NC3CCNCC3)c(F)c2)nc2[nH]ccc12
Standard InChI: InChI=1S/C26H29FN7O2P/c1-37(2,36)22-6-4-3-5-21(22)32-24-19-11-14-29-23(19)33-26(34-24)31-17-7-8-18(20(27)15-17)25(35)30-16-9-12-28-13-10-16/h3-8,11,14-16,28H,9-10,12-13H2,1-2H3,(H,30,35)(H3,29,31,32,33,34)
Standard InChI Key: VVHYXEBATZCQFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
5.3058 -3.4062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3046 -4.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0168 -4.6388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7306 -4.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7250 -3.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0150 -2.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1853 -2.1916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0004 -2.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3355 -2.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4438 -4.6356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4485 -5.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7429 -5.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7473 -6.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4579 -7.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1655 -6.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1577 -5.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8609 -5.4349 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
9.5730 -5.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8521 -4.6177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8550 -6.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5925 -4.6379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5918 -5.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8809 -5.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8799 -6.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5914 -7.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3054 -6.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3029 -5.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5919 -7.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8844 -8.3252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2998 -8.3244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3003 -9.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5937 -9.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5922 -10.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2983 -10.7709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0076 -10.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0108 -9.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1717 -7.0947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
6 5 2 0
6 1 1 0
7 6 1 0
8 7 1 0
9 8 2 0
5 9 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
17 19 2 0
17 20 1 0
2 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
31 36 1 0
24 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.54Molecular Weight (Monoisotopic): 521.2104AlogP: 4.31#Rotatable Bonds: 7Polar Surface Area: 123.83Molecular Species: BASEHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.27CX Basic pKa: 9.97CX LogP: 2.54CX LogD: -0.05Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -1.32
References 1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M.. (2019) Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents., 183 [PMID:31550660 ] [10.1016/j.ejmech.2019.111716 ]