The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-[[4-[N-[3-(difluoromethyl)phenyl]-N'-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide ID: ALA4475499
PubChem CID: 142342024
Max Phase: Preclinical
Molecular Formula: C14H16F2N6O5S2
Molecular Weight: 450.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)CC(=O)NCCSc1nonc1/C(=N/O)Nc1cccc(C(F)F)c1
Standard InChI: InChI=1S/C14H16F2N6O5S2/c15-12(16)8-2-1-3-9(6-8)19-13(20-24)11-14(22-27-21-11)28-5-4-18-10(23)7-29(17,25)26/h1-3,6,12,24H,4-5,7H2,(H,18,23)(H,19,20)(H2,17,25,26)
Standard InChI Key: SRGIOYOXVRHLHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
9.7939 -15.2749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3759 -15.8568 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5889 -15.0619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7733 -16.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7721 -16.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4802 -17.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1899 -16.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1870 -16.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4784 -15.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8932 -15.6235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6024 -16.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3086 -15.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6055 -16.8466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8993 -17.2579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0539 -15.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5984 -15.3413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1871 -14.6351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3885 -14.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2249 -16.7498 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.0025 -17.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6090 -16.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3866 -16.7048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9930 -16.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7706 -16.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8219 -15.3580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1547 -16.1121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0655 -15.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0653 -14.8128 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3579 -16.0387 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
13 14 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 12 2 0
15 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 2 1 0
23 25 2 0
2 26 1 0
4 27 1 0
27 28 1 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.45Molecular Weight (Monoisotopic): 450.0592AlogP: 0.75#Rotatable Bonds: 9Polar Surface Area: 172.80Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.88CX Basic pKa: ┄CX LogP: 0.05CX LogD: -1.43Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.11Np Likeness Score: -1.89
References 1. Steeneck C, Kinzel O, Anderhub S, Hornberger M, Pinto S, Morschhaeuser B, Braun F, Kleymann G, Hoffmann T.. (2020) Discovery of Hydroxyamidine Based Inhibitors of IDO1 for Cancer Immunotherapy with Reduced Potential for Glucuronidation., 11 (2): [PMID:32071686 ] [10.1021/acsmedchemlett.9b00572 ]