The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((2-(dimethylphosphoryl)phenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)-N-ethylbenzenesulfonamide ID: ALA4475504
PubChem CID: 155538017
Max Phase: Preclinical
Molecular Formula: C22H25N6O3PS
Molecular Weight: 484.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCNS(=O)(=O)c1ccc(Nc2nc(Nc3ccccc3P(C)(C)=O)c3cc[nH]c3n2)cc1
Standard InChI: InChI=1S/C22H25N6O3PS/c1-4-24-33(30,31)16-11-9-15(10-12-16)25-22-27-20-17(13-14-23-20)21(28-22)26-18-7-5-6-8-19(18)32(2,3)29/h5-14,24H,4H2,1-3H3,(H3,23,25,26,27,28)
Standard InChI Key: AFAMZLQOFLGRBD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
34.7637 -8.0446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9754 -8.2592 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.5554 -8.8346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9786 -7.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2665 -7.0356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2675 -6.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9798 -5.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9804 -4.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6926 -4.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6937 -3.7514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4030 -3.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1129 -3.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1186 -4.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4048 -4.9841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8317 -4.9809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8365 -5.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1308 -6.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1352 -7.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8458 -7.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5535 -7.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5456 -6.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2489 -5.7801 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
38.9610 -6.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2401 -4.9630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2430 -6.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7235 -3.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3883 -2.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5732 -2.5369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6906 -6.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6931 -7.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2715 -8.6718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2720 -9.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5645 -9.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 1 0
10 9 2 0
11 10 1 0
11 12 2 0
13 12 1 0
14 13 2 0
9 14 1 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
21 22 1 0
22 23 1 0
22 24 2 0
22 25 1 0
12 26 1 0
26 27 2 0
27 28 1 0
28 11 1 0
29 7 1 0
30 29 2 0
4 30 1 0
2 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.52Molecular Weight (Monoisotopic): 484.1446AlogP: 3.99#Rotatable Bonds: 8Polar Surface Area: 128.87Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.63CX Basic pKa: 4.89CX LogP: 3.11CX LogD: 3.10Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.37
References 1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M.. (2019) Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents., 183 [PMID:31550660 ] [10.1016/j.ejmech.2019.111716 ]