11-Deoxy-12beta-hydroxy-16beta-methoxy alisol A 24-acetate

ID: ALA4475517

PubChem CID: 155537881

Max Phase: Preclinical

Molecular Formula: C33H54O7

Molecular Weight: 562.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@H]1C[C@@]2(C)C(=C1[C@H](C)C[C@H](O)[C@@H](OC(C)=O)C(C)(C)O)[C@H](O)C[C@H]1[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@@]12C

Standard InChI:  InChI=1S/C33H54O7/c1-18(15-21(36)28(30(5,6)38)40-19(2)34)26-22(39-10)17-33(9)27(26)20(35)16-24-31(7)13-12-25(37)29(3,4)23(31)11-14-32(24,33)8/h18,20-24,28,35-36,38H,11-17H2,1-10H3/t18-,20-,21+,22+,23+,24+,28-,31+,32+,33+/m1/s1

Standard InChI Key:  MMSCSHVTCNYOAT-VWDUMGLQSA-N

Molfile:  

 
     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   38.8290   -7.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4245   -6.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0114   -7.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7187   -5.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7187   -6.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4281   -4.9362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1334   -5.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1300   -6.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8361   -6.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5503   -6.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8431   -4.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5499   -5.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5666   -3.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8484   -4.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2735   -4.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2601   -4.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0340   -5.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5273   -4.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0556   -3.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3498   -2.9788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1559   -2.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7546   -3.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8130   -2.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8360   -5.7616    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.1261   -4.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5418   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1220   -6.9874    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.2558   -5.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0075   -6.5840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.5565   -3.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0936   -3.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8955   -3.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8287   -4.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6678   -4.3584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.8214   -2.3924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.6233   -2.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8882   -1.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1604   -2.8511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5766   -2.9014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.3444   -4.5785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.7425   -5.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5062   -3.9966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  6
 11 24  1  1
  7 25  1  1
 12 26  1  6
  8 27  1  6
 16 28  1  1
  5 29  2  0
 22 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 30 35  1  1
 35 36  1  0
 36 37  1  0
 36 38  2  0
 13 39  1  1
 18 40  1  1
 40 41  1  0
 22 42  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4475517

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 562.79Molecular Weight (Monoisotopic): 562.3870AlogP: 4.99#Rotatable Bonds: 7
Polar Surface Area: 113.29Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.76CX Basic pKa: CX LogP: 3.68CX LogD: 3.68
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: 2.71

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source