The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Methoxy-5-nitro-2-(3,4,5-trimethoxybenzyl)naphthalen-1-ol ID: ALA4475521
PubChem CID: 155537884
Max Phase: Preclinical
Molecular Formula: C21H21NO7
Molecular Weight: 399.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Cc2ccc3c([N+](=O)[O-])c(OC)ccc3c2O)cc(OC)c1OC
Standard InChI: InChI=1S/C21H21NO7/c1-26-16-8-7-15-14(19(16)22(24)25)6-5-13(20(15)23)9-12-10-17(27-2)21(29-4)18(11-12)28-3/h5-8,10-11,23H,9H2,1-4H3
Standard InChI Key: QWEBWSBCVTUOMT-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
3.8823 -8.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8812 -9.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5892 -9.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5874 -8.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1731 -9.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4657 -9.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2938 -8.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2949 -9.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0093 -9.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7232 -9.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7182 -8.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0031 -8.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9985 -7.4691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4232 -8.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1336 -8.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1373 -9.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8467 -9.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5528 -9.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5449 -8.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8348 -8.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2485 -8.2516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9602 -8.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2636 -9.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2700 -10.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8516 -10.7190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1463 -11.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5909 -10.7545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2984 -11.1633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8830 -11.1628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 8 2 0
7 4 2 0
4 1 1 0
2 5 1 0
5 6 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
17 25 1 0
25 26 1 0
27 28 2 0
27 29 1 0
3 27 1 0
M CHG 2 27 1 29 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.40Molecular Weight (Monoisotopic): 399.1318AlogP: 4.08#Rotatable Bonds: 7Polar Surface Area: 100.29Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.57CX Basic pKa: ┄CX LogP: 4.06CX LogD: 4.03Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: 0.18
References 1. Maguire CJ, Carlson GJ, Ford JW, Strecker TE, Hamel E, Trawick ML, Pinney KG.. (2019) Synthesis and biological evaluation of structurally diverse α-conformationally restricted chalcones and related analogues., 10 (8): [PMID:31534659 ] [10.1039/C9MD00127A ]