The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[5-(10-Methyl-10H-phenothiazin-3-ylmethylene)-4-oxo-2-thioxothiazolidin-3-yl]acetic acid 2,2-dimethyl[1,3]dioxolan-4-ylmethyl ester ID: ALA4475538
PubChem CID: 155538092
Max Phase: Preclinical
Molecular Formula: C25H24N2O5S3
Molecular Weight: 528.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1c2ccccc2Sc2cc(/C=C3/SC(=S)N(CC(=O)OCC4COC(C)(C)O4)C3=O)ccc21
Standard InChI: InChI=1S/C25H24N2O5S3/c1-25(2)31-14-16(32-25)13-30-22(28)12-27-23(29)21(35-24(27)33)11-15-8-9-18-20(10-15)34-19-7-5-4-6-17(19)26(18)3/h4-11,16H,12-14H2,1-3H3/b21-11+
Standard InChI Key: IPHJRUZANDHSCX-SRZZPIQSSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
13.7458 -7.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9208 -7.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3333 -7.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7486 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7474 -3.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4623 -3.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4605 -2.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1758 -2.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1746 -3.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8915 -3.9364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8939 -2.2702 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.6154 -2.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6140 -3.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3302 -3.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0480 -3.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0453 -2.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3286 -2.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8910 -4.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7582 -2.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4742 -2.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5610 -3.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3686 -3.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7786 -2.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2242 -2.3397 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9492 -4.0516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5987 -2.8615 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7069 -4.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5277 -4.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8660 -5.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0102 -3.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6867 -5.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0250 -6.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6181 -6.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1723 -7.4194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8356 -6.2610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 1 0
16 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
21 25 2 0
23 26 2 0
22 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 2 1 0
2 35 1 0
35 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.68Molecular Weight (Monoisotopic): 528.0847AlogP: 4.82#Rotatable Bonds: 5Polar Surface Area: 68.31Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.85CX LogD: 4.85Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -0.97
References 1. Li Y, Yan L, Cai J, Zhang W, Li L, Du Z, Dong C, Meunier B, Chen H.. (2019) Development of novel theranostic agents for in vivo amyloid imaging and protective effects on human neuroblastoma cells., 181 [PMID:31404860 ] [10.1016/j.ejmech.2019.111585 ]