The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(4-(4-(1-(5-amino-2-fluoro-3-(trifluoromethyl)phenyl)ethylamino)-7-methoxy-2-methylquinazolin-6-yl)piperidin-1-yl)ethanone ID: ALA4475551
PubChem CID: 155537814
Max Phase: Preclinical
Molecular Formula: C26H29F4N5O2
Molecular Weight: 519.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nc(C)nc(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3F)c2cc1C1CCN(C(C)=O)CC1
Standard InChI: InChI=1S/C26H29F4N5O2/c1-13(18-9-17(31)10-21(24(18)27)26(28,29)30)32-25-20-11-19(16-5-7-35(8-6-16)15(3)36)23(37-4)12-22(20)33-14(2)34-25/h9-13,16H,5-8,31H2,1-4H3,(H,32,33,34)/t13-/m1/s1
Standard InChI Key: ZIYRSSBEELSVRD-CYBMUJFWSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
10.5252 -6.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3851 -6.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9622 -7.8626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2469 -4.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3996 -8.6862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6841 -7.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2458 -6.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9551 -6.6175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1133 -9.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5361 -3.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6837 -4.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5319 -7.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9631 -6.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8236 -8.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2413 -6.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6835 -9.1007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9617 -8.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9615 -3.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2443 -9.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2458 -4.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4000 -7.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9633 -5.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1100 -7.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2431 -7.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6843 -6.6207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6865 -4.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6727 -6.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8200 -7.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9529 -7.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6748 -5.3914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3885 -3.7163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5376 -2.9041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8276 -4.1285 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8247 -3.3100 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.5369 -5.3706 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.5320 -9.0920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5332 -9.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 17 1 0
21 6 1 0
8 27 1 0
4 10 1 0
4 20 2 0
14 28 2 0
17 16 2 0
15 1 1 0
5 9 2 0
22 26 2 0
27 2 1 0
16 5 1 0
23 21 2 0
24 29 1 0
12 24 1 0
9 14 1 0
25 6 1 0
26 11 1 0
29 8 1 0
6 3 2 0
12 28 1 0
28 23 1 0
20 22 1 0
13 25 1 0
12 1 1 0
8 15 1 0
21 5 1 0
11 18 2 0
22 13 1 0
17 19 1 0
18 4 1 0
13 7 1 6
27 30 2 0
11 31 1 0
10 32 1 0
10 33 1 0
10 34 1 0
20 35 1 0
14 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.54Molecular Weight (Monoisotopic): 519.2257AlogP: 5.59#Rotatable Bonds: 5Polar Surface Area: 93.37Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.24CX LogP: 4.09CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.03
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,