The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{4-[3,5-Bis(trifluoromethyl)phenoxy]phenyl}-2-chloro-6-fluorobenzamide ID: ALA4475557
PubChem CID: 2741936
Max Phase: Preclinical
Molecular Formula: C21H11ClF7NO2
Molecular Weight: 477.76
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)c1c(F)cccc1Cl
Standard InChI: InChI=1S/C21H11ClF7NO2/c22-16-2-1-3-17(23)18(16)19(31)30-13-4-6-14(7-5-13)32-15-9-11(20(24,25)26)8-12(10-15)21(27,28)29/h1-10H,(H,30,31)
Standard InChI Key: ZBTXLIOBUPNJDF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
27.2342 -3.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2330 -4.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9411 -5.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6507 -4.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6479 -3.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9393 -3.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3541 -3.4482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0633 -3.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0631 -4.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7715 -5.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4786 -4.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4729 -3.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7639 -3.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1884 -5.0685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8940 -4.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6038 -5.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8898 -3.8391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6053 -5.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3143 -6.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0208 -5.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0140 -5.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3045 -4.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2972 -3.8311 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.9409 -5.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2331 -6.3172 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.6485 -6.3175 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.9331 -6.7233 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.5264 -3.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5262 -2.6374 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.8187 -3.8634 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.8158 -3.0459 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8989 -6.2892 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
22 23 1 0
3 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
1 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
18 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.76Molecular Weight (Monoisotopic): 477.0367AlogP: 7.56#Rotatable Bonds: 4Polar Surface Area: 38.33Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.98CX Basic pKa: ┄CX LogP: 7.07CX LogD: 7.07Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.48
References 1. Padilla-Salinas R, Anderson R, Sakaniwa K, Zhang S, Nordeen P, Lu C, Shimizu T, Yin H.. (2019) Discovery of Novel Small Molecule Dual Inhibitors Targeting Toll-Like Receptors 7 and 8., 62 (22): [PMID:31687820 ] [10.1021/acs.jmedchem.9b01201 ]