(S)-1-(4-fluorobenzyl)-N-(4-methoxybenzyl)-5-oxopyrrolidine-2-carboximidamide hydrochloride

ID: ALA4475566

PubChem CID: 155537989

Max Phase: Preclinical

Molecular Formula: C20H23ClFN3O2

Molecular Weight: 355.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=N)[C@@H]2CCC(=O)N2Cc2ccc(F)cc2)cc1.Cl

Standard InChI:  InChI=1S/C20H22FN3O2.ClH/c1-26-17-8-4-14(5-9-17)12-23-20(22)18-10-11-19(25)24(18)13-15-2-6-16(21)7-3-15;/h2-9,18H,10-13H2,1H3,(H2,22,23);1H/t18-;/m0./s1

Standard InChI Key:  KPURVPHBPJBKAJ-FERBBOLQSA-N

Molfile:  

     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   43.8724  -19.1751    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.9154  -17.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9143  -18.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6223  -19.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3320  -18.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3292  -17.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6205  -17.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0353  -17.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7446  -17.8413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8322  -18.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6322  -18.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0381  -18.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4890  -17.5056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2267  -19.2019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.6554  -16.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4314  -16.4496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0457  -16.1614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.0411  -16.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8172  -16.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4227  -17.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1982  -17.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3652  -16.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7506  -15.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9775  -15.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2063  -19.0778    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   46.1410  -15.9722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.7514  -16.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 10 14  2  0
 13 15  1  6
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  3 25  1  0
 22 26  1  0
 26 27  1  0
M  END

Associated Targets(Human)

SH-SY5Y (11521 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 355.41Molecular Weight (Monoisotopic): 355.1696AlogP: 3.09#Rotatable Bonds: 6
Polar Surface Area: 65.42Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.31CX LogP: 2.31CX LogD: 0.01
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.62Np Likeness Score: -0.88

References

1. Zhang L, Quan J, Zhao Y, Yang D, Zhao Q, Liu P, Cheng M, Ma C..  (2019)  Design, synthesis and biological evaluation of 1-benzyl-5-oxopyrrolidine-2-carboximidamide derivatives as novel neuroprotective agents.,  182  [PMID:31494474] [10.1016/j.ejmech.2019.111654]

Source