The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Phenyl-N-(5-(4-(5-(2-(4-(p-tolyl)-1H-1,2,3-triazol-1-yl)-acetamido)-1,3,4-thiadiazol-2-yl)but-yl)-1,3,4-thiadiazol-2-yl)-acetamide ID: ALA4475576
PubChem CID: 155537996
Max Phase: Preclinical
Molecular Formula: C27H27N9O2S2
Molecular Weight: 573.71
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2cn(CC(=O)Nc3nnc(CCCCc4nnc(NC(=O)Cc5ccccc5)s4)s3)nn2)cc1
Standard InChI: InChI=1S/C27H27N9O2S2/c1-18-11-13-20(14-12-18)21-16-36(35-30-21)17-23(38)29-27-34-32-25(40-27)10-6-5-9-24-31-33-26(39-24)28-22(37)15-19-7-3-2-4-8-19/h2-4,7-8,11-14,16H,5-6,9-10,15,17H2,1H3,(H,28,33,37)(H,29,34,38)
Standard InChI Key: ZJPFHPRTSVMWLU-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
4.2142 -13.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9222 -13.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6263 -13.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6263 -14.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9247 -15.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2142 -14.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3385 -13.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0466 -13.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7547 -13.4023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4669 -13.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2135 -13.4787 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7610 -14.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3495 -14.7955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5520 -14.6266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5805 -14.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9881 -14.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8076 -14.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2152 -15.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0347 -15.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5158 -14.8426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2941 -15.0967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2941 -15.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5158 -16.1656 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.0062 -16.3233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7143 -15.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4224 -16.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1305 -15.9115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2156 -15.0990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0172 -14.9301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4246 -15.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8771 -16.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2440 -15.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6562 -14.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4721 -14.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8799 -15.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4730 -16.3474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6542 -16.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6994 -15.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7143 -15.0962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0466 -14.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
12 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 19 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 27 1 0
30 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
35 38 1 0
25 39 2 0
8 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.71Molecular Weight (Monoisotopic): 573.1729AlogP: 4.34#Rotatable Bonds: 12Polar Surface Area: 140.47Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.57CX Basic pKa: 0.41CX LogP: 4.63CX LogD: 3.49Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.76
References 1. Xu X, Kuang Z, Han J, Meng Y, Li L, Luan H, Xu P, Wang J, Luo C, Ding H, Li Z, Bian J.. (2019) Development and Characterization of a Fluorescent Probe for GLS1 and the Application for High-Throughput Screening of Allosteric Inhibitors., 62 (21): [PMID:31603674 ] [10.1021/acs.jmedchem.9b01035 ]