2-Imino-10-methyl-1-(4-methylphenethyl)-5-oxo-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxylic Acid

ID: ALA4475578

PubChem CID: 155537998

Max Phase: Preclinical

Molecular Formula: C22H20N4O3

Molecular Weight: 388.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(CCn2c(=N)c(C(=O)O)cc3c(=O)n4cccc(C)c4nc32)cc1

Standard InChI:  InChI=1S/C22H20N4O3/c1-13-5-7-15(8-6-13)9-11-25-18(23)16(22(28)29)12-17-20(25)24-19-14(2)4-3-10-26(19)21(17)27/h3-8,10,12,23H,9,11H2,1-2H3,(H,28,29)

Standard InChI Key:  XVPUQSHWFUFESR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.5465   -6.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5465   -7.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2559   -7.5446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2559   -5.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9612   -6.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9622   -7.1360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6707   -7.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6686   -5.9029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3815   -6.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3818   -7.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0916   -7.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8056   -7.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8053   -6.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0910   -5.9008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6699   -8.3669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5174   -5.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5170   -7.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5162   -8.3704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0896   -5.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2569   -5.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2255   -7.1419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7966   -4.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7952   -3.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5039   -3.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5028   -2.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7939   -2.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0845   -2.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0891   -3.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7914   -1.4050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  7 15  2  0
 13 16  2  0
 12 17  1  0
 17 18  2  0
 14 19  1  0
  4 20  1  0
 17 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475578

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.43Molecular Weight (Monoisotopic): 388.1535AlogP: 2.69#Rotatable Bonds: 4
Polar Surface Area: 100.45Molecular Species: ZWITTERIONHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 0.41CX Basic pKa: 9.66CX LogP: 1.29CX LogD: 1.29
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -1.18

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source