The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(Dimethylamino)-N-(4-{2-[(4-oxo-4H-chromen-7-yl)-oxy]acetamido}-2-(trifluoromethyl)phenyl)benzamide ID: ALA4475590
PubChem CID: 155537815
Max Phase: Preclinical
Molecular Formula: C27H22F3N3O5
Molecular Weight: 525.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(C(=O)Nc2ccc(NC(=O)COc3ccc4c(=O)ccoc4c3)cc2C(F)(F)F)cc1
Standard InChI: InChI=1S/C27H22F3N3O5/c1-33(2)18-6-3-16(4-7-18)26(36)32-22-10-5-17(13-21(22)27(28,29)30)31-25(35)15-38-19-8-9-20-23(34)11-12-37-24(20)14-19/h3-14H,15H2,1-2H3,(H,31,35)(H,32,36)
Standard InChI Key: CHFJKTSSIYVLLZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
26.1988 -16.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9068 -16.5319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9068 -17.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6190 -16.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6190 -15.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3209 -14.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0333 -15.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0333 -16.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3274 -16.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7413 -14.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7413 -14.0762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4535 -15.3034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1616 -14.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1616 -14.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8635 -13.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5800 -14.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5800 -14.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8699 -15.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8699 -16.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5780 -16.5348 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.1619 -16.5348 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.8699 -16.9425 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.2881 -13.6672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9962 -14.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9962 -14.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7042 -13.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4123 -14.0790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1245 -13.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8328 -14.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5410 -13.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2493 -14.0712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9512 -13.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9512 -12.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2448 -12.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2448 -11.6245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5410 -12.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8303 -12.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1245 -12.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
4 2 1 0
5 4 1 0
6 5 2 0
7 6 1 0
8 7 2 0
9 8 1 0
4 9 2 0
10 7 1 0
10 11 2 0
12 10 1 0
13 12 1 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
13 18 2 0
18 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
23 16 1 0
24 23 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
36 34 1 0
30 36 1 0
36 37 2 0
37 38 1 0
38 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.48Molecular Weight (Monoisotopic): 525.1512AlogP: 5.15#Rotatable Bonds: 7Polar Surface Area: 100.88Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.54CX Basic pKa: 3.16CX LogP: 4.50CX LogD: 4.50Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -1.36
References 1. Zhao L, Li Y, Wang Y, Qiao Z, Miao Z, Yang J, Huang L, Tian C, Li L, Chen D, Yang S.. (2019) Discovery of 4H-Chromen-4-one Derivatives as a New Class of Selective Rho Kinase (ROCK) Inhibitors, which Showed Potent Activity in ex Vivo Diabetic Retinopathy Models., 62 (23): [PMID:31693351 ] [10.1021/acs.jmedchem.9b01143 ]