N-(((1S,2R,4S,5S)-5-((4-benzylpiperidin-1-yl)methyl)quinuclidin-2-yl)methyl)benzo[d][1,3]dioxole-5-carboxamide

ID: ALA4475595

PubChem CID: 40779692

Max Phase: Preclinical

Molecular Formula: C29H37N3O3

Molecular Weight: 475.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC[C@H]1C[C@@H]2CC[N@@]1C[C@@H]2CN1CCC(Cc2ccccc2)CC1)c1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C29H37N3O3/c33-29(24-6-7-27-28(16-24)35-20-34-27)30-17-26-15-23-10-13-32(26)19-25(23)18-31-11-8-22(9-12-31)14-21-4-2-1-3-5-21/h1-7,16,22-23,25-26H,8-15,17-20H2,(H,30,33)/t23-,25-,26+/m0/s1

Standard InChI Key:  XUMIOPFRZHMENK-AYRHNUGRSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    3.8621  -15.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5796  -15.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5767  -14.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8603  -13.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1462  -15.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1429  -14.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3571  -14.0818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8733  -14.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3625  -15.4181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2865  -13.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0036  -14.3203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2834  -13.0867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7176  -13.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4346  -14.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4354  -15.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1484  -15.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8648  -15.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8637  -14.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1461  -13.8980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5803  -15.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2959  -15.1371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5711  -14.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8616  -14.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0025  -15.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7159  -15.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7202  -14.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0048  -13.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2893  -14.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4372  -13.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1512  -14.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1453  -15.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8583  -15.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5764  -15.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5769  -14.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8632  -13.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1437  -16.3746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 14 13  1  6
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  6
 20 21  1  0
 19 22  1  1
 22 23  1  0
 16 23  1  0
 21 24  1  0
 21 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 16 36  1  1
M  END

Associated Targets(Human)

PRMT5 Tchem Protein arginine N-methyltransferase 5 (1273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.63Molecular Weight (Monoisotopic): 475.2835AlogP: 3.81#Rotatable Bonds: 7
Polar Surface Area: 54.04Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.19CX LogP: 3.81CX LogD: 1.05
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.66Np Likeness Score: -0.68

References

1. Zhu K, Song JL, Tao HR, Cheng ZQ, Jiang CS, Zhang H..  (2018)  Discovery of new potent protein arginine methyltransferase 5 (PRMT5) inhibitors by assembly of key pharmacophores from known inhibitors.,  28  (23-24): [PMID:30366617] [10.1016/j.bmcl.2018.10.026]

Source