The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(((1S,2R,4S,5S)-5-((4-benzylpiperidin-1-yl)methyl)quinuclidin-2-yl)methyl)benzo[d][1,3]dioxole-5-carboxamide ID: ALA4475595
PubChem CID: 40779692
Max Phase: Preclinical
Molecular Formula: C29H37N3O3
Molecular Weight: 475.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC[C@H]1C[C@@H]2CC[N@@]1C[C@@H]2CN1CCC(Cc2ccccc2)CC1)c1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C29H37N3O3/c33-29(24-6-7-27-28(16-24)35-20-34-27)30-17-26-15-23-10-13-32(26)19-25(23)18-31-11-8-22(9-12-31)14-21-4-2-1-3-5-21/h1-7,16,22-23,25-26H,8-15,17-20H2,(H,30,33)/t23-,25-,26+/m0/s1
Standard InChI Key: XUMIOPFRZHMENK-AYRHNUGRSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
3.8621 -15.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5796 -15.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5767 -14.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8603 -13.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1462 -15.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1429 -14.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3571 -14.0818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8733 -14.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -15.4181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2865 -13.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0036 -14.3203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2834 -13.0867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7176 -13.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4346 -14.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4354 -15.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1484 -15.5512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8648 -15.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8637 -14.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1461 -13.8980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5803 -15.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2959 -15.1371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5711 -14.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8616 -14.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0025 -15.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7159 -15.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7202 -14.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0048 -13.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2893 -14.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4372 -13.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1512 -14.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1453 -15.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8583 -15.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5764 -15.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5769 -14.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8632 -13.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -16.3746 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
14 13 1 6
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
17 20 1 6
20 21 1 0
19 22 1 1
22 23 1 0
16 23 1 0
21 24 1 0
21 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
16 36 1 1
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.63Molecular Weight (Monoisotopic): 475.2835AlogP: 3.81#Rotatable Bonds: 7Polar Surface Area: 54.04Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.19CX LogP: 3.81CX LogD: 1.05Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.66Np Likeness Score: -0.68
References 1. Zhu K, Song JL, Tao HR, Cheng ZQ, Jiang CS, Zhang H.. (2018) Discovery of new potent protein arginine methyltransferase 5 (PRMT5) inhibitors by assembly of key pharmacophores from known inhibitors., 28 (23-24): [PMID:30366617 ] [10.1016/j.bmcl.2018.10.026 ]