1,4-dihydroxy-2-(hydroxy(4-(trifluoromethyl)phenyl)methyl)anthracene-9,10-dione

ID: ALA4475610

PubChem CID: 141750630

Max Phase: Preclinical

Molecular Formula: C22H13F3O5

Molecular Weight: 414.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccccc2C(=O)c2c(O)c(C(O)c3ccc(C(F)(F)F)cc3)cc(O)c21

Standard InChI:  InChI=1S/C22H13F3O5/c23-22(24,25)11-7-5-10(6-8-11)18(27)14-9-15(26)16-17(21(14)30)20(29)13-4-2-1-3-12(13)19(16)28/h1-9,18,26-27,30H

Standard InChI Key:  UGGOPBUNKZYMRM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.5002   -5.1384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5002   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7949   -4.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7975   -3.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0937   -3.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3869   -3.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3883   -4.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0927   -5.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2055   -3.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2039   -4.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9081   -5.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6144   -4.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6120   -3.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9072   -3.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4988   -2.6868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5014   -5.9556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9074   -5.9566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9053   -2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3184   -3.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3158   -2.6859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0239   -3.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0252   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7334   -5.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4407   -4.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4355   -3.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7267   -3.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1536   -5.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7993   -5.4937    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.2937   -5.9673    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.9505   -4.8177    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475610

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.33Molecular Weight (Monoisotopic): 414.0715AlogP: 3.97#Rotatable Bonds: 2
Polar Surface Area: 94.83Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.49CX Basic pKa: CX LogP: 5.51CX LogD: 5.47
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: 0.42

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source