The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-3-(4-((1-(4-nitrophenyl)-9H-pyrido[3,4-b]indol-3-ylamino)methyl)phenyl)acrylamide ID: ALA4475613
PubChem CID: 155537865
Max Phase: Preclinical
Molecular Formula: C27H21N5O4
Molecular Weight: 479.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(CNc2cc3c([nH]c4ccccc43)c(-c3ccc([N+](=O)[O-])cc3)n2)cc1)NO
Standard InChI: InChI=1S/C27H21N5O4/c33-25(31-34)14-9-17-5-7-18(8-6-17)16-28-24-15-22-21-3-1-2-4-23(21)29-27(22)26(30-24)19-10-12-20(13-11-19)32(35)36/h1-15,29,34H,16H2,(H,28,30)(H,31,33)/b14-9+
Standard InChI Key: PSLBYNPIDJYPNR-NTEUORMPSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
31.1155 -17.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1153 -18.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8325 -18.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5484 -18.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5427 -17.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8249 -17.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2561 -17.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9755 -17.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6889 -17.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4084 -17.7243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6830 -16.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4144 -18.5509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9867 -21.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7051 -21.0712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7023 -20.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9849 -19.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4130 -19.8210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2700 -21.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2666 -20.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4852 -21.3287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9952 -20.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4806 -19.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1475 -19.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3293 -19.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8453 -19.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1811 -20.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4064 -18.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9884 -22.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2744 -22.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2738 -23.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9866 -23.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7013 -23.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6984 -22.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9857 -24.7748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6984 -25.1852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2738 -25.1868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
18 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 19 1 0
15 17 1 0
18 19 2 0
19 22 1 0
21 20 1 0
20 18 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 27 1 0
27 2 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
13 28 1 0
34 35 2 0
34 36 1 0
31 34 1 0
M CHG 2 34 1 36 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.50Molecular Weight (Monoisotopic): 479.1594AlogP: 5.42#Rotatable Bonds: 7Polar Surface Area: 133.18Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.56CX Basic pKa: 5.52CX LogP: 4.99CX LogD: 4.98Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.11Np Likeness Score: -0.58
References 1. Ling Y, Gao WJ, Ling C, Liu J, Meng C, Qian J, Liu S, Gan H, Wu H, Tao J, Dai H, Zhang Y.. (2019) β-Carboline and N-hydroxycinnamamide hybrids as anticancer agents for drug-resistant hepatocellular carcinoma., 168 [PMID:30851694 ] [10.1016/j.ejmech.2019.02.054 ]