The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R,4S,5R)-2-(6-(4-([1,1'-Biphenyl]-4-yl)piperazin-1-yl)-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol ID: ALA4475619
PubChem CID: 155537886
Max Phase: Preclinical
Molecular Formula: C26H28N6O4
Molecular Weight: 488.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@H]1O[C@@H](n2cnc3c(N4CCN(c5ccc(-c6ccccc6)cc5)CC4)ncnc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C26H28N6O4/c33-14-20-22(34)23(35)26(36-20)32-16-29-21-24(27-15-28-25(21)32)31-12-10-30(11-13-31)19-8-6-18(7-9-19)17-4-2-1-3-5-17/h1-9,15-16,20,22-23,26,33-35H,10-14H2/t20-,22-,23-,26-/m1/s1
Standard InChI Key: UWJIVFICFJJKOS-HUBRGWSESA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
36.0834 -10.0168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0939 -8.6934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6110 -9.3515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8713 -8.9535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8581 -9.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5592 -10.1951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2780 -9.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2912 -8.9763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5856 -8.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5976 -7.7346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3182 -7.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3322 -6.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6324 -6.1020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9170 -6.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9013 -7.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8206 -10.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0406 -11.0382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0314 -11.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8057 -12.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2934 -11.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1105 -11.4702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0495 -12.8967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3649 -12.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6221 -11.9874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6458 -5.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3626 -4.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3780 -4.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6774 -3.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9599 -4.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9479 -4.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6926 -2.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4089 -2.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4232 -1.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7221 -1.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0051 -1.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9942 -2.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 2 0
4 9 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
16 1 1 1
20 21 1 6
19 22 1 6
18 23 1 1
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
13 25 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
28 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.55Molecular Weight (Monoisotopic): 488.2172AlogP: 1.43#Rotatable Bonds: 5Polar Surface Area: 120.00Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.45CX Basic pKa: 3.65CX LogP: 2.23CX LogD: 2.23Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.02
References 1. Crespo RA, Dang Q, Zhou NE, Guthrie LM, Snavely TC, Dong W, Loesch KA, Suzuki T, You L, Wang W, O'Malley T, Parish T, Olsen DB, Sacchettini JC.. (2019) Structure-Guided Drug Design of 6-Substituted Adenosine Analogues as Potent Inhibitors of Mycobacterium tuberculosis Adenosine Kinase., 62 (9): [PMID:31002508 ] [10.1021/acs.jmedchem.9b00020 ]