The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-methoxy-5-((4-(1-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)pyrimidin-2-yl)amino)-2-(4-methylpiperazin-1-yl)phenyl)acrylamide ID: ALA4475620
PubChem CID: 126667225
Max Phase: Preclinical
Molecular Formula: C27H30N8O2
Molecular Weight: 498.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4cccnc34)n2)c(OC)cc1N1CCN(C)CC1
Standard InChI: InChI=1S/C27H30N8O2/c1-5-25(36)30-20-15-21(24(37-4)16-23(20)35-13-11-33(2)12-14-35)32-27-29-10-8-19(31-27)18-17-34(3)22-7-6-9-28-26(18)22/h5-10,15-17H,1,11-14H2,2-4H3,(H,30,36)(H,29,31,32)
Standard InChI Key: BPAGAPMSJBUTKT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
35.5629 -10.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5618 -11.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2698 -12.1450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2680 -10.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9766 -10.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9814 -11.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7615 -11.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2388 -11.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7537 -10.6554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0172 -12.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4722 -13.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7287 -14.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5297 -14.3024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0739 -13.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8145 -12.9144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7782 -14.0945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4863 -13.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1916 -14.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8991 -13.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9002 -12.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1878 -12.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4832 -12.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1856 -11.6486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4768 -11.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4746 -10.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7702 -11.6525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1811 -10.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1882 -14.9174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4789 -15.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6077 -12.4658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0017 -9.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3127 -12.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0181 -12.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0218 -11.6545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3141 -11.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6025 -11.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7309 -11.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
18 28 1 0
28 29 1 0
20 30 1 0
9 31 1 0
30 32 1 0
30 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.59Molecular Weight (Monoisotopic): 498.2492AlogP: 3.66#Rotatable Bonds: 7Polar Surface Area: 100.44Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.60CX Basic pKa: 7.56CX LogP: 3.48CX LogD: 3.09Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.37Np Likeness Score: -1.13
References 1. Zhou P, Chen G, Gao M, Wu J.. (2018) Design, synthesis and evaluation of the osimertinib analogue (C-005) as potent EGFR inhibitor against NSCLC., 26 (23-24): [PMID:30442506 ] [10.1016/j.bmc.2018.10.018 ]