The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-Peniphenone E ID: ALA4475663
PubChem CID: 54680454
Max Phase: Preclinical
Molecular Formula: C16H16O8
Molecular Weight: 336.30
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cc(C)c(O)c(CC2=C(O)C(CC(=O)O)OC2=O)c1O
Standard InChI: InChI=1S/C16H16O8/c1-6-3-8(7(2)17)14(21)9(13(6)20)4-10-15(22)11(5-12(18)19)24-16(10)23/h3,11,20-22H,4-5H2,1-2H3,(H,18,19)
Standard InChI Key: UUIXAUNVUMHZTJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
14.5447 -2.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5435 -3.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2583 -4.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9748 -3.7685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9720 -2.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2565 -2.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6899 -4.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6912 -5.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0254 -5.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2815 -6.2700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1067 -6.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3603 -5.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1437 -5.2251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5927 -6.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2584 -7.6895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7444 -8.3562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4380 -7.7771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6849 -2.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2541 -1.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9674 -1.2892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5384 -1.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8288 -4.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2581 -5.0070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2004 -5.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 2 0
12 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
5 18 1 0
6 19 1 0
19 20 2 0
19 21 1 0
2 22 1 0
3 23 1 0
9 24 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 336.30Molecular Weight (Monoisotopic): 336.0845AlogP: 1.36#Rotatable Bonds: 5Polar Surface Area: 141.36Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.32CX Basic pKa: ┄CX LogP: 1.73CX LogD: -4.19Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.47Np Likeness Score: 1.39
References 1. El-Kashef DH, Daletos G, Plenker M, Hartmann R, Mándi A, Kurtán T, Weber H, Lin W, Ancheeva E, Proksch P.. (2019) Polyketides and a Dihydroquinolone Alkaloid from a Marine-Derived Strain of the Fungus Metarhizium marquandii ., 82 (9): [PMID:31432669 ] [10.1021/acs.jnatprod.9b00125 ]