Ethyl 4-(8-Fluoro-2-(methyl(1-methylpyrrolidin-3-yl)-amino)-4-oxoquinazolin-3(4H)-yl)-benzoate

ID: ALA4475671

PubChem CID: 155537944

Max Phase: Preclinical

Molecular Formula: C23H25FN4O3

Molecular Weight: 424.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(-n2c(N(C)C3CCN(C)C3)nc3c(F)cccc3c2=O)cc1

Standard InChI:  InChI=1S/C23H25FN4O3/c1-4-31-22(30)15-8-10-16(11-9-15)28-21(29)18-6-5-7-19(24)20(18)25-23(28)27(3)17-12-13-26(2)14-17/h5-11,17H,4,12-14H2,1-3H3

Standard InChI Key:  ZDUAXBRYIMGFRP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   21.0103  -21.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0092  -22.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7172  -22.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7154  -21.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4240  -21.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4274  -22.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1398  -22.8556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8534  -22.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8500  -21.6172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1330  -21.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1285  -20.3881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5554  -21.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2646  -21.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9706  -21.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9685  -20.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2546  -19.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5515  -20.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5622  -22.8490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7158  -23.6723    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.6770  -19.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3865  -20.3778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6734  -19.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0924  -19.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8019  -20.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5644  -23.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2688  -22.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9080  -24.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1626  -24.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9799  -24.9211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2302  -24.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4621  -25.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  9 12  1  0
  8 18  1  0
  3 19  1  0
 20 21  1  0
 20 22  2  0
 15 20  1  0
 21 23  1  0
 23 24  1  0
 18 25  1  0
 18 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 25  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475671

    ---

Associated Targets(Human)

TRPV4 Tchem Transient receptor potential cation channel subfamily V member 4 (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.48Molecular Weight (Monoisotopic): 424.1911AlogP: 2.84#Rotatable Bonds: 5
Polar Surface Area: 67.67Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.41CX LogP: 3.39CX LogD: 2.34
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -1.20

References

1. Atobe M, Nagami T, Muramatsu S, Ohno T, Kitagawa M, Suzuki H, Ishiguro M, Watanabe A, Kawanishi M..  (2019)  Discovery of Novel Transient Receptor Potential Vanilloid 4 (TRPV4) Agonists as Regulators of Chondrogenic Differentiation: Identification of Quinazolin-4(3 H)-ones and in Vivo Studies on a Surgically Induced Rat Model of Osteoarthritis.,  62  (3): [PMID:30629441] [10.1021/acs.jmedchem.8b01615]

Source