The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((2-(5-Chloro-2-methoxyphenyl)cyclopropyl)methyl)-N-(cyclopropylmethyl)-3-((4-methyl-5-phenyl-4H-1,2,4-triazol-3-yl)thio)propan-1-amine Hydrochloride ID: ALA4475699
PubChem CID: 155537907
Max Phase: Preclinical
Molecular Formula: C27H34Cl2N4OS
Molecular Weight: 497.11
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cl)cc1C1CC1CN(CCCSc1nnc(-c2ccccc2)n1C)CC1CC1.Cl
Standard InChI: InChI=1S/C27H33ClN4OS.ClH/c1-31-26(20-7-4-3-5-8-20)29-30-27(31)34-14-6-13-32(17-19-9-10-19)18-21-15-23(21)24-16-22(28)11-12-25(24)33-2;/h3-5,7-8,11-12,16,19,21,23H,6,9-10,13-15,17-18H2,1-2H3;1H
Standard InChI Key: SMWNOTWKMBPIIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
36.2703 -5.5797 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.3585 -2.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0740 -2.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7895 -2.9994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5008 -2.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2163 -2.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9319 -2.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6473 -2.9994 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.3628 -2.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1161 -2.9222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6657 -2.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2550 -1.5921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4474 -1.7629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4828 -2.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8202 -3.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6405 -3.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1242 -2.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7860 -1.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9667 -1.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5329 -2.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9436 -3.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8175 -2.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8224 -1.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1077 -1.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3912 -1.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3939 -2.5879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1091 -2.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1123 -3.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3984 -4.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2856 -3.7217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7895 -3.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5008 -4.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1081 -0.5217 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.9105 -4.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3212 -4.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
11 14 1 0
20 2 1 0
21 20 1 0
2 21 1 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 1 0
10 30 1 0
4 31 1 0
31 32 1 0
24 33 1 0
34 32 1 0
35 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.11Molecular Weight (Monoisotopic): 496.2064AlogP: 6.14#Rotatable Bonds: 12Polar Surface Area: 43.18Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.34CX LogP: 5.86CX LogD: 3.02Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: -1.37
References 1. Tan L, Zhou Q, Yan W, Sun J, Kozikowski AP, Zhao S, Huang XP, Cheng J.. (2020) Design and Synthesis of Bitopic 2-Phenylcyclopropylmethylamine (PCPMA) Derivatives as Selective Dopamine D3 Receptor Ligands., 63 (9): [PMID:32282200 ] [10.1021/acs.jmedchem.9b01835 ]