The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3E,5E)-3-(4-pyridylmethylene)-5-(3,4,5-trimethoxybenzylidene)-1-methylpiperidin-4-one ID: ALA4475718
PubChem CID: 155537694
Max Phase: Preclinical
Molecular Formula: C22H24N2O4
Molecular Weight: 380.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2\CN(C)C/C(=C\c3ccncc3)C2=O)cc(OC)c1OC
Standard InChI: InChI=1S/C22H24N2O4/c1-24-13-17(9-15-5-7-23-8-6-15)21(25)18(14-24)10-16-11-19(26-2)22(28-4)20(12-16)27-3/h5-12H,13-14H2,1-4H3/b17-9+,18-10+
Standard InChI Key: XIMRJAJPDFCREW-BEQMOXJMSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
13.0860 -22.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0849 -23.1726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7929 -23.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5026 -23.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4998 -22.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7911 -21.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2059 -21.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9152 -22.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9157 -23.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6208 -23.5644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3294 -23.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3283 -22.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6186 -21.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6208 -24.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6146 -21.1109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0359 -21.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7437 -22.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7393 -23.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4463 -23.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1548 -23.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1519 -22.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4443 -21.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8580 -21.9214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5673 -22.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4462 -24.3803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7385 -24.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8632 -23.5616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8646 -24.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
10 14 1 0
13 15 2 0
12 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
19 25 1 0
25 26 1 0
20 27 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.44Molecular Weight (Monoisotopic): 380.1736AlogP: 3.09#Rotatable Bonds: 5Polar Surface Area: 60.89Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.29CX LogP: 2.59CX LogD: 2.59Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: -0.25
References 1. Yao BR, Sun Y, Chen SL, Suo HD, Zhang YL, Wei H, Wang CH, Zhao F, Cong W, Xin WY, Hou GG.. (2019) Dissymmetric pyridyl-substituted 3,5-bis(arylidene)-4-piperidones as anti-hepatoma agents by inhibiting NF-κB pathway activation., 167 [PMID:30771605 ] [10.1016/j.ejmech.2019.02.020 ]