The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(5-((6-(4-Bromobenzyloxy)naphthalen-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)-3-(1H-indol-3-yl)propanoic acid ID: ALA4475724
PubChem CID: 155537698
Max Phase: Preclinical
Molecular Formula: C32H23BrN2O4S2
Molecular Weight: 643.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(Cc1c[nH]c2ccccc12)N1C(=O)/C(=C/c2ccc3cc(OCc4ccc(Br)cc4)ccc3c2)SC1=S
Standard InChI: InChI=1S/C32H23BrN2O4S2/c33-24-10-6-19(7-11-24)18-39-25-12-9-21-13-20(5-8-22(21)15-25)14-29-30(36)35(32(40)41-29)28(31(37)38)16-23-17-34-27-4-2-1-3-26(23)27/h1-15,17,28,34H,16,18H2,(H,37,38)/b29-14-
Standard InChI Key: NZUUNLGIKOLXCV-NUJZUDFISA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
32.2529 -7.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2517 -8.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9598 -9.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9580 -7.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6666 -7.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6674 -8.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3759 -9.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0842 -8.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0794 -7.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3703 -7.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5451 -7.5282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7935 -9.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4996 -8.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2436 -9.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7880 -8.4646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3767 -7.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5781 -7.9315 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.7061 -7.0105 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.4151 -9.8730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6011 -8.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9364 -9.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0788 -7.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8919 -7.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2986 -8.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0972 -8.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4316 -7.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1767 -7.6853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8318 -7.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7431 -6.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9937 -6.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3417 -6.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4611 -9.9566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7519 -9.3759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8375 -7.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1296 -7.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1331 -6.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4261 -6.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7175 -6.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7204 -7.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4279 -7.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0092 -6.3037 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 1 0
8 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
16 18 2 0
14 19 2 0
15 20 1 0
20 21 1 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 27 1 0
26 23 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 32 1 0
21 33 2 0
11 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 643.58Molecular Weight (Monoisotopic): 642.0283AlogP: 7.56#Rotatable Bonds: 8Polar Surface Area: 82.63Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.96CX Basic pKa: ┄CX LogP: 8.09CX LogD: 4.91Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.13Np Likeness Score: -0.89
References 1. Liu H, Sun D, Du H, Zheng C, Li J, Piao H, Li J, Sun L.. (2019) Synthesis and biological evaluation of tryptophan-derived rhodanine derivatives as PTP1B inhibitors and anti-bacterial agents., 172 [PMID:30978561 ] [10.1016/j.ejmech.2019.03.059 ]