The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,2'E)-N,N'-(Disulfanediylbis(ethane-2,1-diyl))bis(2-(hydroxyimino)-3-(4-methylphenyl)propanamide) ID: ALA4475727
PubChem CID: 155537700
Max Phase: Preclinical
Molecular Formula: C24H24F6N4O4S2
Molecular Weight: 610.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCSSCCNC(=O)/C(Cc1cccc(C(F)(F)F)c1)=N/O)/C(Cc1cccc(C(F)(F)F)c1)=N/O
Standard InChI: InChI=1S/C24H24F6N4O4S2/c25-23(26,27)17-5-1-3-15(11-17)13-19(33-37)21(35)31-7-9-39-40-10-8-32-22(36)20(34-38)14-16-4-2-6-18(12-16)24(28,29)30/h1-6,11-12,37-38H,7-10,13-14H2,(H,31,35)(H,32,36)/b33-19+,34-20+
Standard InChI Key: ZKXGGMLAOLTJLF-ZXHXELASSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
5.6584 -11.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4795 -11.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7696 -11.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3683 -11.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6626 -12.5509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4795 -10.4749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8148 -11.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3232 -11.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9403 -11.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1977 -11.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8148 -12.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3149 -10.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5247 -11.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6133 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9075 -11.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2345 -11.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3683 -10.4997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7779 -12.5261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0598 -11.2962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0823 -11.7255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5247 -12.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6009 -10.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9260 -11.7172 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2120 -11.3086 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.8993 -10.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2428 -12.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1894 -10.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9527 -12.9636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5021 -11.7172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6359 -11.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3499 -11.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7922 -11.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5203 -13.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5185 -14.5413 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 -14.3356 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1810 -14.3389 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.0357 -11.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6813 -12.0553 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.1756 -12.5288 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.8326 -11.3794 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 19 1 0
4 1 1 0
5 1 2 0
6 2 2 0
7 13 1 0
8 14 1 0
9 1 1 0
10 2 1 0
11 21 1 0
12 22 1 0
13 16 2 0
14 15 2 0
15 10 1 0
16 9 1 0
17 4 2 0
18 3 2 0
19 31 1 0
20 4 1 0
21 26 2 0
22 25 2 0
23 24 1 0
24 29 1 0
25 15 1 0
26 16 1 0
27 6 1 0
28 5 1 0
29 32 1 0
30 23 1 0
31 30 1 0
32 20 1 0
11 7 2 0
12 8 2 0
33 34 1 0
33 35 1 0
33 36 1 0
21 33 1 0
37 38 1 0
37 39 1 0
37 40 1 0
8 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 610.60Molecular Weight (Monoisotopic): 610.1143AlogP: 4.78#Rotatable Bonds: 13Polar Surface Area: 123.38Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.18CX Basic pKa: ┄CX LogP: 4.91CX LogD: 4.84Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.06Np Likeness Score: -0.22
References 1. Wen J, Bao Y, Niu Q, Liu J, Yang J, Wang W, Jiang T, Fan Y, Li K, Wang J, Zhao L, Liu D.. (2016) Synthesis, biological evaluation and molecular modeling studies of psammaplin A and its analogs as potent histone deacetylases inhibitors and cytotoxic agents., 26 (17): [PMID:27460171 ] [10.1016/j.bmcl.2015.12.094 ]