The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(N-((5-bromo-2-(2-chlorobenzamido)phenyl)(phenyl)methyl)acetamido)acetate ID: ALA4475736
Cas Number: 5807-03-4
PubChem CID: 2870209
Max Phase: Preclinical
Molecular Formula: C25H22BrClN2O4
Molecular Weight: 529.82
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CN(C(C)=O)C(c1ccccc1)c1cc(Br)ccc1NC(=O)c1ccccc1Cl
Standard InChI: InChI=1S/C25H22BrClN2O4/c1-16(30)29(15-23(31)33-2)24(17-8-4-3-5-9-17)20-14-18(26)12-13-22(20)28-25(32)19-10-6-7-11-21(19)27/h3-14,24H,15H2,1-2H3,(H,28,32)
Standard InChI Key: GSPWQWXABHYRBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
7.3300 -11.5356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0377 -11.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7454 -11.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4531 -11.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7454 -12.3528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1608 -11.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3300 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6222 -12.7614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0377 -12.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6222 -11.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6222 -10.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9145 -11.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3333 -9.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3337 -9.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6254 -8.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9154 -9.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9185 -9.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2074 -11.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5002 -11.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4997 -12.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2124 -12.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9167 -12.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2091 -10.3067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5022 -9.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5038 -9.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7936 -10.3038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2120 -8.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2140 -7.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5066 -7.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7957 -7.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7972 -8.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0909 -9.0873 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.2153 -13.5755 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
1 7 1 0
7 8 2 0
7 9 1 0
1 10 1 0
10 11 1 0
10 12 1 0
11 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 11 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
18 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
31 32 1 0
21 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.82Molecular Weight (Monoisotopic): 528.0451AlogP: 5.47#Rotatable Bonds: 7Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.33
References 1. Turku A, Borrel A, Leino TO, Karhu L, Kukkonen JP, Xhaard H.. (2016) Pharmacophore Model To Discover OX1 and OX2 Orexin Receptor Ligands., 59 (18): [PMID:27546834 ] [10.1021/acs.jmedchem.6b00333 ]