methyl 2-(N-((5-bromo-2-(2-chlorobenzamido)phenyl)(phenyl)methyl)acetamido)acetate

ID: ALA4475736

Cas Number: 5807-03-4

PubChem CID: 2870209

Max Phase: Preclinical

Molecular Formula: C25H22BrClN2O4

Molecular Weight: 529.82

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)CN(C(C)=O)C(c1ccccc1)c1cc(Br)ccc1NC(=O)c1ccccc1Cl

Standard InChI:  InChI=1S/C25H22BrClN2O4/c1-16(30)29(15-23(31)33-2)24(17-8-4-3-5-9-17)20-14-18(26)12-13-22(20)28-25(32)19-10-6-7-11-21(19)27/h3-14,24H,15H2,1-2H3,(H,28,32)

Standard InChI Key:  GSPWQWXABHYRBK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    7.3300  -11.5356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0377  -11.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7454  -11.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4531  -11.1270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7454  -12.3528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1608  -11.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3300  -12.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6222  -12.7614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0377  -12.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6222  -11.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6222  -10.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9145  -11.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3333   -9.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3337   -9.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6254   -8.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9154   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9185   -9.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2074  -11.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5002  -11.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4997  -12.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2124  -12.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9167  -12.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2091  -10.3067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5022   -9.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5038   -9.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7936  -10.3038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2120   -8.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2140   -7.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5066   -7.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7957   -7.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7972   -8.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0909   -9.0873    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.2153  -13.5755    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  1 10  1  0
 10 11  1  0
 10 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 11  1  0
 12 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 12  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 31 32  1  0
 21 33  1  0
M  END

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCRTR1 Tclin Orexin receptor 1 (5435 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CHO (4503 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.82Molecular Weight (Monoisotopic): 528.0451AlogP: 5.47#Rotatable Bonds: 7
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.01CX LogD: 5.01
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.33

References

1. Turku A, Borrel A, Leino TO, Karhu L, Kukkonen JP, Xhaard H..  (2016)  Pharmacophore Model To Discover OX1 and OX2 Orexin Receptor Ligands.,  59  (18): [PMID:27546834] [10.1021/acs.jmedchem.6b00333]

Source