The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{2-[(1R,4S)-6-(5-Cyclobutylamino-4-trifluoromethyl-pyrimidin-2-ylamino)-1,2,3,4-tetrahydro-1,4-epiazano-naphthalen-9-yl]-2-oxo-ethyl}-acetamide ID: ALA4475773
PubChem CID: 155537727
Max Phase: Preclinical
Molecular Formula: C23H25F3N6O2
Molecular Weight: 474.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NCC(=O)N1[C@@H]2CC[C@H]1c1cc(Nc3ncc(NC4CCC4)c(C(F)(F)F)n3)ccc12
Standard InChI: InChI=1S/C23H25F3N6O2/c1-12(33)27-11-20(34)32-18-7-8-19(32)16-9-14(5-6-15(16)18)30-22-28-10-17(29-13-3-2-4-13)21(31-22)23(24,25)26/h5-6,9-10,13,18-19,29H,2-4,7-8,11H2,1H3,(H,27,33)(H,28,30,31)/t18-,19+/m1/s1
Standard InChI Key: WIUBGKOFXQCZTI-MOPGFXCFSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
5.9003 -20.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6017 -20.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5989 -19.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8985 -18.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2005 -20.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2046 -19.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5088 -18.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8085 -19.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8044 -20.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5006 -20.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2968 -18.9241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0019 -19.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0016 -20.1325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7018 -20.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4007 -20.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3950 -19.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6942 -18.9158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1063 -20.5278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1105 -21.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5398 -21.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1164 -22.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6831 -21.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0955 -18.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7980 -19.3035 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0896 -18.0953 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.7913 -18.4929 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2868 -19.7599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4283 -19.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9991 -19.0176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9991 -20.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1407 -20.5023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7114 -21.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8530 -21.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1407 -21.9911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7203 -18.1535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7121 -21.3293 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
3 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 19 1 0
16 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
10 27 1 0
7 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
7 35 1 6
10 36 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.49Molecular Weight (Monoisotopic): 474.1991AlogP: 4.06#Rotatable Bonds: 6Polar Surface Area: 99.25Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.70CX Basic pKa: 1.10CX LogP: 2.15CX LogD: 2.15Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: -1.01
References 1. Valenciano AL, Ramsey AC, Santos WL, Mackey ZB.. (2016) Discovery and antiparasitic activity of AZ960 as a Trypanosoma brucei ERK8 inhibitor., 24 (19): [PMID:27519462 ] [10.1016/j.bmc.2016.07.069 ]