The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[N-acryloyl-(4-chloro-2-fluorophenyl)amino]-6-[3-(morpholin-4-yl)propyloxy]-7-methoxyquinazoline ID: ALA4475780
PubChem CID: 155537733
Max Phase: Preclinical
Molecular Formula: C25H26ClFN4O4
Molecular Weight: 500.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N(c1ccc(Cl)cc1F)c1ncnc2cc(OC)c(OCCCN3CCOCC3)cc12
Standard InChI: InChI=1S/C25H26ClFN4O4/c1-3-24(32)31(21-6-5-17(26)13-19(21)27)25-18-14-23(22(33-2)15-20(18)28-16-29-25)35-10-4-7-30-8-11-34-12-9-30/h3,5-6,13-16H,1,4,7-12H2,2H3
Standard InChI Key: NUEKSAINFNILIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
42.6136 -18.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3153 -18.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6136 -19.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9038 -18.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0210 -18.4405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9038 -19.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3153 -17.2105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1980 -18.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1980 -19.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4490 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3235 -19.6704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.7392 -17.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6403 -18.0401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.0293 -19.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0210 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4490 -15.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2082 -17.2229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.7309 -15.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0210 -15.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4840 -18.0319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4840 -19.6745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3461 -18.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0560 -18.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6362 -17.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9263 -18.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2164 -18.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9263 -16.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7741 -18.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7741 -19.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6073 -16.8024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6068 -15.9852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8998 -17.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1919 -16.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7412 -18.0277 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.1563 -15.5713 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 2 0
5 2 2 0
6 3 2 0
7 2 1 0
8 4 1 0
9 8 2 0
10 12 1 0
11 3 1 0
12 15 2 0
13 22 1 0
14 11 2 0
15 7 1 0
16 18 1 0
17 26 1 0
18 19 2 0
19 15 1 0
20 8 1 0
21 9 1 0
22 23 1 0
23 28 1 0
24 13 1 0
25 13 1 0
26 25 1 0
27 24 1 0
28 20 1 0
29 21 1 0
6 9 1 0
14 5 1 0
10 16 2 0
27 17 1 0
7 30 1 0
30 31 2 0
30 32 1 0
32 33 2 0
12 34 1 0
16 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.96Molecular Weight (Monoisotopic): 500.1627AlogP: 4.38#Rotatable Bonds: 9Polar Surface Area: 77.02Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.84CX LogP: 3.83CX LogD: 3.72Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -1.39
References 1. Wu KD, Chen GS, Liu JR, Hsieh CE, Chern JW.. (2019) Acrylamide Functional Group Incorporation Improves Drug-like Properties: An Example with EGFR Inhibitors., 10 (1): [PMID:30655941 ] [10.1021/acsmedchemlett.8b00270 ]