The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-Benzyl-5-((4-fluorobenzyl)amino)-4,5,6,7-tetrahydro-1H-indazol-3-yl)(piperidin-1-yl)methanone ID: ALA4475785
PubChem CID: 146641787
Max Phase: Preclinical
Molecular Formula: C27H31FN4O
Molecular Weight: 446.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1nn(Cc2ccccc2)c2c1CC(NCc1ccc(F)cc1)CC2)N1CCCCC1
Standard InChI: InChI=1S/C27H31FN4O/c28-22-11-9-20(10-12-22)18-29-23-13-14-25-24(17-23)26(27(33)31-15-5-2-6-16-31)30-32(25)19-21-7-3-1-4-8-21/h1,3-4,7-12,23,29H,2,5-6,13-19H2
Standard InChI Key: LCDYHWCYRPGIBD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
41.4374 -11.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4374 -12.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1468 -12.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1468 -10.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6312 -12.4208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.1120 -11.7623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.6288 -11.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8521 -11.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8535 -12.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8841 -10.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6872 -10.1482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3374 -9.7122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8842 -13.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6836 -13.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9311 -14.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7297 -14.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2771 -13.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0204 -12.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2223 -12.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7290 -10.9466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0220 -11.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3136 -10.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3167 -10.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6091 -9.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9011 -10.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9051 -10.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6133 -11.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1922 -9.7302 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
45.2324 -10.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0324 -10.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2897 -9.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7406 -9.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9341 -9.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 9 1 0
8 4 1 0
8 9 2 0
6 7 2 0
5 6 1 0
7 8 1 0
9 5 1 0
7 10 1 0
10 11 1 0
10 12 2 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
1 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
11 29 1 0
11 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.57Molecular Weight (Monoisotopic): 446.2482AlogP: 4.34#Rotatable Bonds: 6Polar Surface Area: 50.16Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.95CX LogP: 4.68CX LogD: 3.13Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.75
References 1. Iyamu ID, Lv W, Malik N, Mishra RK, Schiltz GE.. (2019) Discovery of a novel class of potent and selective tetrahydroindazole-based sigma-1 receptor ligands., 27 (9): [PMID:30904383 ] [10.1016/j.bmc.2019.03.030 ]