The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(2-methoxy-5-(trifluoromethyl)phenylamino)-5-(trifluoromethyl)pyrimidin-4-yl)isoindolin-4-yl)-N-methylmethanesulfonamide ID: ALA4475794
PubChem CID: 155537833
Max Phase: Preclinical
Molecular Formula: C23H21F6N5O3S
Molecular Weight: 561.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(F)(F)F)cc1Nc1ncc(C(F)(F)F)c(N2Cc3cccc(N(C)S(C)(=O)=O)c3C2)n1
Standard InChI: InChI=1S/C23H21F6N5O3S/c1-33(38(3,35)36)18-6-4-5-13-11-34(12-15(13)18)20-16(23(27,28)29)10-30-21(32-20)31-17-9-14(22(24,25)26)7-8-19(17)37-2/h4-10H,11-12H2,1-3H3,(H,30,31,32)
Standard InChI Key: QTEZQMACSVBJMM-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
10.7927 -17.3839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5822 -18.1763 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3737 -17.9624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1329 -17.4004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1317 -18.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8398 -18.6289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5494 -18.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5466 -17.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8380 -16.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2583 -18.6245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3450 -19.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0043 -18.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5521 -18.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1462 -19.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5542 -20.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3681 -20.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7721 -19.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3618 -18.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2539 -16.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8965 -16.6091 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0533 -17.2838 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.3870 -16.1397 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.4237 -18.6279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7661 -18.1833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9961 -18.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3534 -17.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4230 -19.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7149 -19.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7139 -20.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4218 -21.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1322 -20.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1297 -19.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0079 -19.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2995 -19.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8419 -21.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4869 -21.4468 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.9805 -21.9194 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6393 -20.7710 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 14 1 0
13 12 1 0
12 10 1 0
7 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 1 0
19 21 1 0
19 22 1 0
8 19 1 0
5 23 1 0
18 24 1 0
24 2 1 0
2 25 1 0
24 26 1 0
23 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
28 33 1 0
33 34 1 0
35 36 1 0
35 37 1 0
35 38 1 0
31 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.51Molecular Weight (Monoisotopic): 561.1269AlogP: 5.18#Rotatable Bonds: 6Polar Surface Area: 87.66Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.33CX Basic pKa: 3.50CX LogP: 4.54CX LogD: 4.54Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.36
References 1. Choi MJ, Roh EJ, Hur W, Lee SH, Sim T, Oh CH, Lee SH, Kim JS, Yoo KH.. (2018) Design, synthesis, and biological evaluation of novel aminopyrimidinylisoindolines as AXL kinase inhibitors., 28 (23-24): [PMID:30340900 ] [10.1016/j.bmcl.2018.10.013 ]