1,8-Bis(benzyloxy)-9,10-anthraquinone-N-(2-hydroxyethyl)-3-carboxamide

ID: ALA4475798

PubChem CID: 141535401

Max Phase: Preclinical

Molecular Formula: C31H25NO6

Molecular Weight: 507.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCCO)c1cc(OCc2ccccc2)c2c(c1)C(=O)c1cccc(OCc3ccccc3)c1C2=O

Standard InChI:  InChI=1S/C31H25NO6/c33-15-14-32-31(36)22-16-24-28(26(17-22)38-19-21-10-5-2-6-11-21)30(35)27-23(29(24)34)12-7-13-25(27)37-18-20-8-3-1-4-9-20/h1-13,16-17,33H,14-15,18-19H2,(H,32,36)

Standard InChI Key:  RRVUAYGQABVWME-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    8.1013  -14.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1013  -13.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3960  -14.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3985  -13.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6948  -13.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9880  -13.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9894  -14.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6938  -14.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8066  -13.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8050  -14.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5092  -14.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2155  -14.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2131  -13.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5083  -13.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1025  -15.6174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0998  -12.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5063  -12.3550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6964  -12.3551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9895  -11.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9911  -11.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2131  -11.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2111  -11.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7024  -10.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7043   -9.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9969   -9.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2860   -9.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2876  -10.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9198  -10.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9182   -9.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2090   -9.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4999   -9.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5050  -10.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9236  -14.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9244  -15.6194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6309  -14.3929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3390  -14.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0463  -14.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7544  -14.7993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1 15  2  0
  2 16  2  0
 14 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  1  0
 17 21  1  0
 21 22  1  0
 20 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 20  1  0
 22 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 22  1  0
 12 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475798

    ---

Associated Targets(Human)

SMMC-7721 (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CNE-2 (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CNE (323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.54Molecular Weight (Monoisotopic): 507.1682AlogP: 4.34#Rotatable Bonds: 9
Polar Surface Area: 101.93Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.56CX Basic pKa: CX LogP: 4.44CX LogD: 4.44
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.02

References

1. Tian W, Li J, Su Z, Lan F, Li Z, Liang D, Wang C, Li D, Hou H..  (2019)  Novel Anthraquinone Compounds Induce Cancer Cell Death through Paraptosis.,  10  (5): [PMID:31097991] [10.1021/acsmedchemlett.8b00624]

Source