The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(6-(dimethylamino)pyridin-3-yl)-1-(3-(trifluoromethyl)phenyl)benzo[h][1,6]naphthyridin-2(1H)-one ID: ALA4475823
PubChem CID: 118087423
Max Phase: Preclinical
Molecular Formula: C26H19F3N4O
Molecular Weight: 460.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(-c2ccc3ncc4ccc(=O)n(-c5cccc(C(F)(F)F)c5)c4c3c2)cn1
Standard InChI: InChI=1S/C26H19F3N4O/c1-32(2)23-10-7-17(14-31-23)16-6-9-22-21(12-16)25-18(15-30-22)8-11-24(34)33(25)20-5-3-4-19(13-20)26(27,28)29/h3-15H,1-2H3
Standard InChI Key: ZSUQUJXUAVOABB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
17.9603 -5.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9591 -6.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6672 -6.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6654 -4.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3740 -5.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3748 -6.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0833 -6.6043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7916 -6.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0777 -4.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7834 -5.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4823 -4.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4767 -4.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7664 -3.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0704 -4.1603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3620 -3.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3551 -2.9438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6441 -2.5425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9396 -2.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9505 -3.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6620 -4.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7575 -2.9309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6362 -1.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3400 -1.3099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.9246 -1.3236 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6303 -0.9080 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.2545 -4.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2557 -4.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5487 -3.7470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5505 -5.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8430 -4.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8405 -4.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1323 -3.7480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1312 -2.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4251 -4.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 15 1 0
13 21 2 0
17 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
26 27 2 0
27 28 1 0
28 31 2 0
30 29 2 0
29 26 1 0
1 26 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.46Molecular Weight (Monoisotopic): 460.1511AlogP: 5.69#Rotatable Bonds: 3Polar Surface Area: 51.02Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.02CX LogP: 5.29CX LogD: 5.27Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.38
References 1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W.. (2019) Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent., 175 [PMID:31082764 ] [10.1016/j.ejmech.2019.04.048 ]