The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-(5-chloropyridin-2-yl)-1-(3-fluoro-5-(trifluoromethyl)phenyl)-2-phenylethyl)-4,4,4-trifluoro-2,3-dihydroxy-3-(trifluoromethyl)butanamide ID: ALA4475826
PubChem CID: 58920284
Max Phase: Preclinical
Molecular Formula: C25H17ClF10N2O3
Molecular Weight: 618.86
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@](Cc1ccccc1)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(Cl)cn1)C(O)C(O)(C(F)(F)F)C(F)(F)F
Standard InChI: InChI=1S/C25H17ClF10N2O3/c26-16-6-7-18(37-12-16)21(11-13-4-2-1-3-5-13,14-8-15(23(28,29)30)10-17(27)9-14)38-20(40)19(39)22(41,24(31,32)33)25(34,35)36/h1-10,12,19,39,41H,11H2,(H,38,40)/t19?,21-/m0/s1
Standard InChI Key: GLMCCQBMCHEBOW-QWAKEFERSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
28.2014 -3.2688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3842 -3.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7928 -3.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9850 -5.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6927 -5.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2773 -5.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9850 -6.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9809 -4.9114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6865 -4.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6824 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4004 -5.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3979 -6.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1048 -6.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8135 -6.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8108 -5.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1034 -5.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2750 -6.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2747 -7.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9829 -8.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6930 -7.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6898 -6.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5668 -8.1772 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.2822 -4.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5754 -4.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8667 -4.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8693 -5.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5768 -5.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1584 -4.0942 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.4064 -8.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0517 -8.5416 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.5457 -9.0147 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.2036 -7.8658 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.9726 -3.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3839 -2.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1656 -4.6223 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.4903 -4.7766 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.6369 -4.1146 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.3794 -1.7134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.0405 -1.9170 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.7185 -1.9174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2106 -5.0446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 6
4 6 1 0
4 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
5 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 7 1 0
18 22 1 0
6 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 6 1 0
25 28 1 0
29 30 1 0
29 31 1 0
29 32 1 0
20 29 1 0
10 2 1 0
10 33 1 0
2 34 1 0
3 35 1 0
3 36 1 0
3 37 1 0
34 38 1 0
34 39 1 0
34 40 1 0
9 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 618.86Molecular Weight (Monoisotopic): 618.0768AlogP: 5.71#Rotatable Bonds: 7Polar Surface Area: 82.45Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.22CX Basic pKa: 1.72CX LogP: 5.89CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -0.73
References 1. Finlay HJ, Jiang J, Rampulla R, Salvati ME, Qiao JX, Wang TC, Lawrence RM, Harikrishnan LS, Kamau MG, Taylor DS, Chen AYA, Yin X, Huang CS, Chang M, Chen XQ, Sleph PG, Xu C, Li J, Levesque P, Adam LP, Wexler RR.. (2019) Discovery of a Lead Triphenylethanamine Cholesterol Ester Transfer Protein (CETP) Inhibitor., 10 (6): [PMID:31223447 ] [10.1021/acsmedchemlett.9b00086 ]