The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (S)-6-Cyano-4-(1H-indazole-7-carboxamido)spiro[chromane-2,4'-piperidine]-1'-carboxylate ID: ALA4475838
PubChem CID: 155537896
Max Phase: Preclinical
Molecular Formula: C25H25N5O4
Molecular Weight: 459.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)N1CCC2(CC1)C[C@H](NC(=O)c1cccc3cn[nH]c13)c1cc(C#N)ccc1O2
Standard InChI: InChI=1S/C25H25N5O4/c1-2-33-24(32)30-10-8-25(9-11-30)13-20(19-12-16(14-26)6-7-21(19)34-25)28-23(31)18-5-3-4-17-15-27-29-22(17)18/h3-7,12,15,20H,2,8-11,13H2,1H3,(H,27,29)(H,28,31)/t20-/m0/s1
Standard InChI Key: NBNKYQUCAWIQCV-FQEVSTJZSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
16.6453 -27.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6366 -27.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3374 -28.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0514 -27.9353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0565 -27.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3513 -26.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9345 -27.5132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6508 -26.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9415 -25.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2266 -27.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2275 -26.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5186 -25.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8085 -26.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8152 -27.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5246 -27.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7587 -28.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7488 -29.1735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4759 -27.9494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1833 -28.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9485 -25.0517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6608 -24.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6657 -23.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3696 -25.0587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6780 -22.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9598 -22.5976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9596 -23.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3873 -22.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3783 -23.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1532 -23.6801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6426 -23.0247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1686 -22.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8948 -27.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0965 -25.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3870 -25.4706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
10 7 1 0
7 1 1 0
1 8 1 0
8 9 1 0
9 11 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
4 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
9 20 1 1
20 21 1 0
21 22 1 0
21 23 2 0
22 28 2 0
27 24 2 0
24 25 1 0
25 26 2 0
26 22 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 27 1 0
19 32 1 0
33 34 3 0
13 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.51Molecular Weight (Monoisotopic): 459.1907AlogP: 3.68#Rotatable Bonds: 3Polar Surface Area: 120.34Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.50CX Basic pKa: 1.20CX LogP: 1.90CX LogD: 1.89Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.62Np Likeness Score: -1.48
References 1. Kazmierski WM, Xia B, Miller J, De la Rosa M, Favre D, Dunham RM, Washio Y, Zhu Z, Wang F, Mebrahtu M, Deng H, Basilla J, Wang L, Evindar G, Fan L, Olszewski A, Prabhu N, Davie C, Messer JA, Samano V.. (2020) DNA-Encoded Library Technology-Based Discovery, Lead Optimization, and Prodrug Strategy toward Structurally Unique Indoleamine 2,3-Dioxygenase-1 (IDO1) Inhibitors., 63 (7): [PMID:32073266 ] [10.1021/acs.jmedchem.9b01799 ]