The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-isopropyl-4-(5-methyl-1H-pyrazol-3-ylamino)-7-(2-morpholinoethoxy)phthalazin-1(2H)-one ID: ALA4475847
PubChem CID: 11668744
Max Phase: Preclinical
Molecular Formula: C21H28N6O3
Molecular Weight: 412.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Nc2nn(C(C)C)c(=O)c3cc(OCCN4CCOCC4)ccc23)n[nH]1
Standard InChI: InChI=1S/C21H28N6O3/c1-14(2)27-21(28)18-13-16(30-11-8-26-6-9-29-10-7-26)4-5-17(18)20(25-27)22-19-12-15(3)23-24-19/h4-5,12-14H,6-11H2,1-3H3,(H2,22,23,24,25)
Standard InChI Key: HWBBVGKLCBLJGG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
6.8374 -18.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8363 -18.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5443 -19.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5425 -17.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2511 -18.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2500 -18.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9562 -19.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6680 -18.9747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6692 -18.1540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9585 -17.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9585 -16.9233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3779 -17.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0846 -18.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3799 -16.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9539 -20.1989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2450 -20.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5014 -20.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9529 -20.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3595 -21.5895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1593 -21.4217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1404 -20.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1296 -17.7472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4220 -18.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7142 -17.7476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0066 -18.1563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2990 -17.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5935 -18.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5895 -18.9698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2971 -19.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0088 -18.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 1 0
12 14 1 0
7 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 16 2 0
18 21 1 0
1 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.49Molecular Weight (Monoisotopic): 412.2223AlogP: 2.46#Rotatable Bonds: 7Polar Surface Area: 97.30Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.41CX LogP: 2.11CX LogD: 2.06Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -1.62
References 1. Sangshetti J, Pathan SK, Patil R, Akber Ansari S, Chhajed S, Arote R, Shinde DB.. (2019) Synthesis and biological activity of structurally diverse phthalazine derivatives: A systematic review., 27 (18): [PMID:31401008 ] [10.1016/j.bmc.2019.07.050 ]