The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(4-(3-chlorophenylsulfonyl)benzyl)-1,4'-bipiperidin-1'-yl)(o-tolyl)methanone ID: ALA4475862
PubChem CID: 155538050
Max Phase: Preclinical
Molecular Formula: C31H35ClN2O3S
Molecular Weight: 551.15
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C(=O)N1CCC(N2CCC(Cc3ccc(S(=O)(=O)c4cccc(Cl)c4)cc3)CC2)CC1
Standard InChI: InChI=1S/C31H35ClN2O3S/c1-23-5-2-3-8-30(23)31(35)34-19-15-27(16-20-34)33-17-13-25(14-18-33)21-24-9-11-28(12-10-24)38(36,37)29-7-4-6-26(32)22-29/h2-12,22,25,27H,13-21H2,1H3
Standard InChI Key: WVWPLXWWZCMNOG-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
9.8641 -0.8997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2768 -1.6096 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.6852 -0.8972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1581 -2.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1570 -2.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8650 -3.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5747 -2.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5718 -2.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8632 -1.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8648 -4.0721 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.9873 -2.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9870 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6954 -3.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4026 -2.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3968 -2.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6879 -1.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1123 -3.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1165 -4.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4053 -4.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4075 -5.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1155 -5.6845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8229 -5.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8224 -4.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1176 -6.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4087 -6.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4078 -7.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1142 -8.1342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8232 -7.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8257 -6.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1122 -8.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4035 -9.3582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8189 -9.3617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6994 -8.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9911 -9.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9887 -10.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7003 -10.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4057 -10.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1142 -10.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
8 2 1 0
2 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
21 24 1 0
27 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.15Molecular Weight (Monoisotopic): 550.2057AlogP: 6.04#Rotatable Bonds: 6Polar Surface Area: 57.69Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.16CX LogP: 6.09CX LogD: 5.25Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -1.38
References 1. Pegoli A, Wifling D, Gruber CG, She X, Hübner H, Bernhardt G, Gmeiner P, Keller M.. (2019) Conjugation of Short Peptides to Dibenzodiazepinone-Type Muscarinic Acetylcholine Receptor Ligands Determines M2 R Selectivity., 62 (11): [PMID:31074983 ] [10.1021/acs.jmedchem.8b01967 ]