7-Benzyl-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-8,9-dihydro-7H-purine-6-carbonitrile

ID: ALA4475865

PubChem CID: 130299090

Max Phase: Preclinical

Molecular Formula: C28H23N5O3

Molecular Weight: 477.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1ccc(-c2nc(C#N)c3c(n2)n(-c2ccccc2OC)c(=O)n3Cc2ccccc2)cc1

Standard InChI:  InChI=1S/C28H23N5O3/c1-3-36-21-15-13-20(14-16-21)26-30-22(17-29)25-27(31-26)33(23-11-7-8-12-24(23)35-2)28(34)32(25)18-19-9-5-4-6-10-19/h4-16H,3,18H2,1-2H3

Standard InChI Key:  QBIASVLOQQAQAU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   16.8223  -23.3256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5320  -22.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5291  -22.0935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8205  -21.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1143  -22.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1155  -22.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3350  -21.8407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8513  -22.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3330  -23.1692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0341  -22.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0824  -23.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2859  -24.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0346  -24.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5751  -25.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3704  -25.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6252  -24.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2403  -23.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2368  -24.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9443  -24.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6523  -24.1389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6484  -23.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9403  -22.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8145  -20.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8127  -20.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4246  -24.3713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9711  -24.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3612  -24.5454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3636  -25.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0725  -25.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0836  -21.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2846  -20.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0370  -20.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2387  -19.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6901  -20.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9452  -21.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7429  -21.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  9 11  1  0
 11 12  2  0
 11 16  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
  2 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  3  0
  4 23  1  0
 16 25  1  0
 25 26  1  0
 20 27  1  0
 27 28  1  0
 28 29  1  0
  7 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475865

    ---

Associated Targets(Human)

NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.52Molecular Weight (Monoisotopic): 477.1801AlogP: 4.58#Rotatable Bonds: 7
Polar Surface Area: 94.96Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 6.38CX LogD: 6.38
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -1.38

References

1. Huang MR, Hsu YL, Lin TC, Cheng TJ, Li LW, Tseng YW, Chou YS, Liu JH, Pan SH, Fang JM, Wong CH..  (2019)  Structure-guided development of purine amide, hydroxamate, and amidoxime for the inhibition of non-small cell lung cancer.,  181  [PMID:31376567] [10.1016/j.ejmech.2019.07.054]

Source