1-(4-(1H-pyrazolo[3,4-d]pyrimidin-4-yloxy)-3-fluorophenyl)-3-(1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)urea

ID: ALA4475895

PubChem CID: 118489448

Max Phase: Preclinical

Molecular Formula: C17H12F4N8O2

Molecular Weight: 436.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1nc(C(F)(F)F)cc1NC(=O)Nc1ccc(Oc2ncnc3[nH]ncc23)c(F)c1

Standard InChI:  InChI=1S/C17H12F4N8O2/c1-29-13(5-12(28-29)17(19,20)21)26-16(30)25-8-2-3-11(10(18)4-8)31-15-9-6-24-27-14(9)22-7-23-15/h2-7H,1H3,(H2,25,26,30)(H,22,23,24,27)

Standard InChI Key:  COWSMIMAJBATIH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    9.2410  -15.4150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9480  -15.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6592  -15.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9438  -16.6485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4039  -16.7302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9486  -17.3395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5363  -18.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7388  -17.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6549  -17.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5298  -15.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5256  -16.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8144  -17.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1033  -16.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1075  -15.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8187  -15.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3921  -17.0471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6766  -19.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3877  -19.5070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0948  -19.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0990  -18.2766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3920  -17.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6808  -18.2734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3584  -18.6916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8748  -19.3566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8817  -18.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4021  -15.4042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.5764  -15.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8711  -18.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1707  -19.4804    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4827  -19.5605    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6943  -19.0269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  5  9  1  0
  4  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 23 24  1  0
 23 25  2  0
 19 24  1  0
 20 25  1  0
 16 21  1  0
 13 16  1  0
  1 10  1  0
 14 26  1  0
  5 27  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
  7 28  1  0
M  END

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.33Molecular Weight (Monoisotopic): 436.1019AlogP: 3.68#Rotatable Bonds: 4
Polar Surface Area: 122.64Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.39CX Basic pKa: 1.24CX LogP: 2.90CX LogD: 2.86
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -2.41

References

1. Li GB, Ma S, Yang LL, Ji S, Fang Z, Zhang G, Wang LJ, Zhong JM, Xiong Y, Wang JH, Huang SZ, Li LL, Xiang R, Niu D, Chen YC, Yang SY..  (2016)  Drug Discovery against Psoriasis: Identification of a New Potent FMS-like Tyrosine Kinase 3 (FLT3) Inhibitor, 1-(4-((1H-Pyrazolo[3,4-d]pyrimidin-4-yl)oxy)-3-fluorophenyl)-3-(5-(tert-butyl)isoxazol-3-yl)urea, That Showed Potent Activity in a Psoriatic Animal Model.,  59  (18): [PMID:27535613] [10.1021/acs.jmedchem.6b00604]

Source