The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-chlorobenzyl)-1-ethyl-6-(3-fluorobenzyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione ID: ALA4475968
PubChem CID: 155537967
Max Phase: Preclinical
Molecular Formula: C23H23ClFN3O2
Molecular Weight: 427.91
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c2c(c(=O)n(Cc3ccc(Cl)cc3)c1=O)CN(Cc1cccc(F)c1)CC2
Standard InChI: InChI=1S/C23H23ClFN3O2/c1-2-27-21-10-11-26(13-17-4-3-5-19(25)12-17)15-20(21)22(29)28(23(27)30)14-16-6-8-18(24)9-7-16/h3-9,12H,2,10-11,13-15H2,1H3
Standard InChI Key: HNOGKDJWVKXFDK-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
16.8845 -19.0018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8845 -19.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5898 -20.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5898 -18.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2951 -19.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2916 -19.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7071 -19.0078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0006 -18.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7037 -19.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9942 -20.2288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0029 -17.7767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4170 -18.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1756 -18.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4093 -20.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9898 -21.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2800 -21.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1225 -19.0152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1161 -19.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8208 -20.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5316 -19.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5333 -19.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8280 -18.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4691 -19.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7608 -18.5963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0547 -19.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0567 -19.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7706 -20.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4737 -19.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2377 -20.2511 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.3460 -18.5994 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 1 0
8 11 2 0
7 12 1 0
1 13 1 0
9 14 2 0
10 15 1 0
15 16 1 0
12 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
13 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
20 29 1 0
25 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.91Molecular Weight (Monoisotopic): 427.1463AlogP: 3.43#Rotatable Bonds: 5Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.40CX LogP: 3.70CX LogD: 3.40Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -1.73
References 1. Ma Z, Gao G, Fang K, Sun H.. (2019) Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d ]pyrimidine-2,4-dione., 10 (2): [PMID:30783502 ] [10.1021/acsmedchemlett.8b00531 ]