3-(4-chlorobenzyl)-1-ethyl-6-(3-fluorobenzyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione

ID: ALA4475968

PubChem CID: 155537967

Max Phase: Preclinical

Molecular Formula: C23H23ClFN3O2

Molecular Weight: 427.91

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c2c(c(=O)n(Cc3ccc(Cl)cc3)c1=O)CN(Cc1cccc(F)c1)CC2

Standard InChI:  InChI=1S/C23H23ClFN3O2/c1-2-27-21-10-11-26(13-17-4-3-5-19(25)12-17)15-20(21)22(29)28(23(27)30)14-16-6-8-18(24)9-7-16/h3-9,12H,2,10-11,13-15H2,1H3

Standard InChI Key:  HNOGKDJWVKXFDK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.8845  -19.0018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8845  -19.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5898  -20.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5898  -18.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2951  -19.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2916  -19.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7071  -19.0078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0006  -18.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7037  -19.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9942  -20.2288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0029  -17.7767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4170  -18.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1756  -18.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4093  -20.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9898  -21.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2800  -21.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1225  -19.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1161  -19.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8208  -20.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5316  -19.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5333  -19.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8280  -18.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4691  -19.0059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7608  -18.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0547  -19.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0567  -19.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7706  -20.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4737  -19.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2377  -20.2511    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.3460  -18.5994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
  8 11  2  0
  7 12  1  0
  1 13  1  0
  9 14  2  0
 10 15  1  0
 15 16  1  0
 12 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 13 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 20 29  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475968

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.91Molecular Weight (Monoisotopic): 427.1463AlogP: 3.43#Rotatable Bonds: 5
Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.40CX LogP: 3.70CX LogD: 3.40
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -1.73

References

1. Ma Z, Gao G, Fang K, Sun H..  (2019)  Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.,  10  (2): [PMID:30783502] [10.1021/acsmedchemlett.8b00531]

Source