10-(5-fluoropyridin-2-yl)-6-methylspiro[benzo[c]pyrido[3,2-e]azepine-7,1'-cyclopropan]-5(6H)-one

ID: ALA4476013

PubChem CID: 146523789

Max Phase: Preclinical

Molecular Formula: C21H16FN3O

Molecular Weight: 345.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C(=O)c2ncccc2-c2cc(-c3ccc(F)cn3)ccc2C12CC2

Standard InChI:  InChI=1S/C21H16FN3O/c1-25-20(26)19-15(3-2-10-23-19)16-11-13(18-7-5-14(22)12-24-18)4-6-17(16)21(25)8-9-21/h2-7,10-12H,8-9H2,1H3

Standard InChI Key:  IZIKBZZLXHLKOX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
   32.4318   -2.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1416   -2.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1406   -1.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0849   -3.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0837   -4.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7918   -4.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7900   -2.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4979   -4.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4986   -3.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9499   -2.8803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3071   -3.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3776   -4.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6699   -4.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9624   -4.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9613   -5.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6736   -5.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3783   -5.2650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4579   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1243   -3.6221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2538   -5.6747    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.9518   -4.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1465   -4.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9100   -5.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4778   -5.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2853   -5.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5180   -4.9651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  8  2  0
  9  7  2  0
  7  4  1  0
  8  9  1  0
  9  2  1  0
  8 22  1  0
  2 10  1  0
 10 11  1  0
 21 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  5 12  1  0
 10 18  1  0
 11 19  2  0
 15 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476013

    ---

Associated Targets(Human)

GRM3 Tchem Metabotropic glutamate receptor 3 (732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.38Molecular Weight (Monoisotopic): 345.1277AlogP: 4.02#Rotatable Bonds: 1
Polar Surface Area: 46.09Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.12CX LogP: 3.19CX LogD: 3.19
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.43

References

1. Kargbo RB..  (2019)  Allosteric mGluR3 Modulators for the Treatment of Psychiatric Disorders.,  10  (2): [PMID:30783491] [10.1021/acsmedchemlett.8b00619]

Source