4-(((6-Bromo-1H-indazol-4-yl)amino)methyl)benzene-1,2-diol

ID: ALA4476018

PubChem CID: 155538038

Max Phase: Preclinical

Molecular Formula: C14H12BrN3O2

Molecular Weight: 334.17

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1ccc(CNc2cc(Br)cc3[nH]ncc23)cc1O

Standard InChI:  InChI=1S/C14H12BrN3O2/c15-9-4-11(10-7-17-18-12(10)5-9)16-6-8-1-2-13(19)14(20)3-8/h1-5,7,16,19-20H,6H2,(H,17,18)

Standard InChI Key:  HOPBRIGXVRXOKR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    5.2908  -11.0760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0005  -10.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9977   -9.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2890   -9.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5828  -10.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5795   -9.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8019   -9.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3246  -10.2639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073  -10.9225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7088  -11.0741    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    5.2864   -8.6215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9928   -8.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7018   -8.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7025   -9.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4107   -9.8380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1180   -9.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1128   -8.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4040   -8.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8276   -9.8325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8177   -8.1923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  2 10  1  0
  4 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 17 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476018

    ---

Associated Targets(Human)

IDO1 Tchem Indoleamine 2,3-dioxygenase (6650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 334.17Molecular Weight (Monoisotopic): 333.0113AlogP: 3.35#Rotatable Bonds: 3
Polar Surface Area: 81.17Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.25CX Basic pKa: 2.62CX LogP: 2.66CX LogD: 2.65
Aromatic Rings: 3Heavy Atoms: 20QED Weighted: 0.55Np Likeness Score: -0.87

References

1. Yang L, Chen Y, He J, Njoya EM, Chen J, Liu S, Xie C, Huang W, Wang F, Wang Z, Li Y, Qian S..  (2019)  4,6-Substituted-1H-Indazoles as potent IDO1/TDO dual inhibitors.,  27  (6): [PMID:30773421] [10.1016/j.bmc.2019.02.014]

Source