The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-((5-(o-tolyl)-3-1,2,4-oxadiazolyl)methyl)-N7-hydroxy-N1-(4-methoxyphenyl)heptanediamide ID: ALA4476064
PubChem CID: 155537746
Max Phase: Preclinical
Molecular Formula: C24H28N4O5
Molecular Weight: 452.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N(Cc2noc(-c3ccccc3C)n2)C(=O)CCCCCC(=O)NO)cc1
Standard InChI: InChI=1S/C24H28N4O5/c1-17-8-6-7-9-20(17)24-25-21(27-33-24)16-28(18-12-14-19(32-2)15-13-18)23(30)11-5-3-4-10-22(29)26-31/h6-9,12-15,31H,3-5,10-11,16H2,1-2H3,(H,26,29)
Standard InChI Key: JOKHKIHSODTQML-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
19.5905 -23.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5894 -24.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2974 -24.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0071 -24.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0043 -23.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2956 -23.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8814 -24.8477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1740 -24.4385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7104 -23.2052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4197 -23.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1258 -23.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4228 -24.4283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8351 -23.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5412 -23.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2505 -23.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9567 -23.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7074 -22.3880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9981 -21.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9094 -21.1730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1095 -21.0061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7035 -21.7154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2527 -22.3205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8862 -21.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4812 -21.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6646 -20.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2534 -21.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6646 -22.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4798 -22.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6659 -23.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3721 -23.1839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6690 -24.4123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0813 -23.5898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8929 -20.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
9 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
16 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
24 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.2060AlogP: 4.04#Rotatable Bonds: 11Polar Surface Area: 117.79Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: ┄CX LogP: 3.65CX LogD: 3.64Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -1.35
References 1. Yang F, Shan P, Zhao N, Ge D, Zhu K, Jiang CS, Li P, Zhang H.. (2019) Development of hydroxamate-based histone deacetylase inhibitors containing 1,2,4-oxadiazole moiety core with antitumor activities., 29 (1): [PMID:30455152 ] [10.1016/j.bmcl.2018.11.027 ]