N-[4-(1-Cyclobutylpiperidin-4-yloxy)phenyl]-2-(1-ethoxycarbonyl piperazin-4-yl)acetamide dihydrochloride

ID: ALA4476066

PubChem CID: 155537748

Max Phase: Preclinical

Molecular Formula: C24H38Cl2N4O4

Molecular Weight: 444.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)N1CCN(CC(=O)Nc2ccc(OC3CCN(C4CCC4)CC3)cc2)CC1.Cl.Cl

Standard InChI:  InChI=1S/C24H36N4O4.2ClH/c1-2-31-24(30)28-16-14-26(15-17-28)18-23(29)25-19-6-8-21(9-7-19)32-22-10-12-27(13-11-22)20-4-3-5-20;;/h6-9,20,22H,2-5,10-18H2,1H3,(H,25,29);2*1H

Standard InChI Key:  SPHXQTQHNWMMOJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   36.0643  -24.1018    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   33.9691  -21.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9679  -22.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6827  -22.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3991  -22.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3963  -21.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6809  -21.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2545  -21.1457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5402  -21.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8214  -21.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1092  -21.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1051  -22.3774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8196  -22.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5380  -22.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1143  -22.7964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8281  -22.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5432  -22.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8268  -21.5577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2570  -22.3805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3900  -22.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5938  -22.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3775  -23.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1736  -23.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9688  -22.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6804  -22.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6834  -21.5608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9685  -21.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2505  -21.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3988  -21.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1123  -21.5640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4006  -20.3249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8277  -21.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5413  -21.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5857  -24.1607    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 20  1  0
 12 20  1  0
 19 24  1  0
 19 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
M  END

Associated Targets(Human)

HRH3 Tclin Histamine H3 receptor (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.58Molecular Weight (Monoisotopic): 444.2737AlogP: 2.79#Rotatable Bonds: 7
Polar Surface Area: 74.35Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: 9.11CX LogP: 1.93CX LogD: 0.22
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.70Np Likeness Score: -1.45

References

1. Nirogi R, Shinde A, Mohammed AR, Badange RK, Reballi V, Bandyala TR, Saraf SK, Bojja K, Manchineella S, Achanta PK, Kandukuri KK, Subramanian R, Benade V, Palacharla RC, Jayarajan P, Pandey S, Jasti V..  (2019)  Discovery and Development of N-[4-(1-Cyclobutylpiperidin-4-yloxy)phenyl]-2-(morpholin-4-yl)acetamide Dihydrochloride (SUVN-G3031): A Novel, Potent, Selective, and Orally Active Histamine H3 Receptor Inverse Agonist with Robust Wake-Promoting Activity.,  62  (3): [PMID:30629436] [10.1021/acs.jmedchem.8b01280]

Source